|
Name |
7-Methyl-Z-tetradecen-1-ol acetate
|
| Molecular Formula | C17H32O2 | |
| IUPAC Name* |
[(Z)-7-methyltetradec-8-enyl] acetate
|
|
| SMILES |
CCCCC/C=C\C(C)CCCCCCOC(=O)C
|
|
| InChI |
InChI=1S/C17H32O2/c1-4-5-6-7-10-13-16(2)14-11-8-9-12-15-19-17(3)18/h10,13,16H,4-9,11-12,14-15H2,1-3H3/b13-10-
|
|
| InChIKey |
IUOFQMYQDUARQU-RAXLEYEMSA-N
|
|
| Synonyms |
7-Methyl-Z-tetradecen-1-ol acetate; (Z)-7-Methyltetradec-8-en-1-yl acetate; 959269-58-0; [(Z)-7-methyltetradec-8-enyl] acetate; starbld0009085; CHEBI:131377; (8Z)-7-Methyl-8-tetradecenyl acetate #; (8Z)-7-methyl-8-tetradecen-1-yl acetate; (8Z)-7-methyltetradec-8-en-1-yl acetate
|
|
| CAS | NA | |
| PubChem CID | 5363222 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 268.4 | ALogp: | 6.2 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 19 | QED Weighted: | 0.264 |
| Caco-2 Permeability: | -4.677 | MDCK Permeability: | 0.00002620 |
| Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.997 |
| 30% Bioavailability (F30%): | 0.998 |
| Blood-Brain-Barrier Penetration (BBB): | 0.806 | Plasma Protein Binding (PPB): | 95.60% |
| Volume Distribution (VD): | 1.963 | Fu: | 4.86% |
| CYP1A2-inhibitor: | 0.822 | CYP1A2-substrate: | 0.427 |
| CYP2C19-inhibitor: | 0.541 | CYP2C19-substrate: | 0.239 |
| CYP2C9-inhibitor: | 0.396 | CYP2C9-substrate: | 0.798 |
| CYP2D6-inhibitor: | 0.279 | CYP2D6-substrate: | 0.304 |
| CYP3A4-inhibitor: | 0.659 | CYP3A4-substrate: | 0.18 |
| Clearance (CL): | 3.554 | Half-life (T1/2): | 0.688 |
| hERG Blockers: | 0.154 | Human Hepatotoxicity (H-HT): | 0.061 |
| Drug-inuced Liver Injury (DILI): | 0.348 | AMES Toxicity: | 0.012 |
| Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.016 |
| Skin Sensitization: | 0.941 | Carcinogencity: | 0.089 |
| Eye Corrosion: | 0.647 | Eye Irritation: | 0.964 |
| Respiratory Toxicity: | 0.412 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001671 | ![]() |
0.927 | D0O1TC | ![]() |
0.381 | ||
| ENC003059 | ![]() |
0.643 | D05ATI | ![]() |
0.370 | ||
| ENC000494 | ![]() |
0.610 | D0O1PH | ![]() |
0.368 | ||
| ENC001669 | ![]() |
0.553 | D0AY9Q | ![]() |
0.357 | ||
| ENC001205 | ![]() |
0.533 | D0I4DQ | ![]() |
0.356 | ||
| ENC000625 | ![]() |
0.533 | D0OR6A | ![]() |
0.354 | ||
| ENC001675 | ![]() |
0.529 | D0H2YX | ![]() |
0.347 | ||
| ENC001673 | ![]() |
0.521 | D0UE9X | ![]() |
0.341 | ||
| ENC000742 | ![]() |
0.508 | D0Z5SM | ![]() |
0.338 | ||
| ENC001613 | ![]() |
0.493 | D0G2KD | ![]() |
0.337 | ||