|
Name |
Undecyl acetate
|
| Molecular Formula | C13H26O2 | |
| IUPAC Name* |
undecyl acetate
|
|
| SMILES |
CCCCCCCCCCCOC(=O)C
|
|
| InChI |
InChI=1S/C13H26O2/c1-3-4-5-6-7-8-9-10-11-12-15-13(2)14/h3-12H2,1-2H3
|
|
| InChIKey |
CKQGCFFDQIFZFA-UHFFFAOYSA-N
|
|
| Synonyms |
Undecyl acetate; 1731-81-3; Undecanyl acetate; 1-Undecanol, acetate; n-Undecyl acetate; 1-Undecanol, 1-acetate; UNDECYLACETATE; Undecyl alcohol, acetate; Acetic acid undecyl ester; 70Z4PZ8M0S; NSC-23056; UNII-70Z4PZ8M0S; EINECS 217-051-1; AI3-24138; 1-UNDECYL ACETATE; 1-UNDECANOL ACETATE; AMY037; SCHEMBL1300652; CHEMBL2228459; DTXSID80169523; CHEBI:180116; NSC23056; ZINC1848558; LMFA07010220; MFCD00056189; NSC 23056; AKOS024319538; s11867; DB-043925; FT-0633800; BIS(ETHYLENEDIAMINE)PLATINUM(II)CHLORIDE; Q27265902
|
|
| CAS | 1731-81-3 | |
| PubChem CID | 15605 | |
| ChEMBL ID | CHEMBL2228459 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 214.34 | ALogp: | 5.0 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 15 | QED Weighted: | 0.389 |
| Caco-2 Permeability: | -4.61 | MDCK Permeability: | 0.00002310 |
| Pgp-inhibitor: | 0.09 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.993 |
| 30% Bioavailability (F30%): | 0.998 |
| Blood-Brain-Barrier Penetration (BBB): | 0.881 | Plasma Protein Binding (PPB): | 94.56% |
| Volume Distribution (VD): | 1.115 | Fu: | 6.72% |
| CYP1A2-inhibitor: | 0.956 | CYP1A2-substrate: | 0.223 |
| CYP2C19-inhibitor: | 0.676 | CYP2C19-substrate: | 0.115 |
| CYP2C9-inhibitor: | 0.378 | CYP2C9-substrate: | 0.796 |
| CYP2D6-inhibitor: | 0.072 | CYP2D6-substrate: | 0.073 |
| CYP3A4-inhibitor: | 0.207 | CYP3A4-substrate: | 0.112 |
| Clearance (CL): | 3.346 | Half-life (T1/2): | 0.356 |
| hERG Blockers: | 0.147 | Human Hepatotoxicity (H-HT): | 0.011 |
| Drug-inuced Liver Injury (DILI): | 0.403 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.01 |
| Skin Sensitization: | 0.938 | Carcinogencity: | 0.102 |
| Eye Corrosion: | 0.98 | Eye Irritation: | 0.986 |
| Respiratory Toxicity: | 0.579 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000424 | ![]() |
0.737 | D05ATI | ![]() |
0.589 | ||
| ENC000399 | ![]() |
0.723 | D0Z5SM | ![]() |
0.524 | ||
| ENC001257 | ![]() |
0.698 | D07ILQ | ![]() |
0.457 | ||
| ENC000260 | ![]() |
0.680 | D0AY9Q | ![]() |
0.424 | ||
| ENC001152 | ![]() |
0.661 | D0O1PH | ![]() |
0.421 | ||
| ENC000556 | ![]() |
0.660 | D00FGR | ![]() |
0.410 | ||
| ENC000102 | ![]() |
0.653 | D05QNO | ![]() |
0.406 | ||
| ENC000472 | ![]() |
0.653 | D0XN8C | ![]() |
0.384 | ||
| ENC000272 | ![]() |
0.652 | D0Y8DP | ![]() |
0.383 | ||
| ENC000742 | ![]() |
0.647 | D0Z5BC | ![]() |
0.368 | ||