|
Name |
6,9,12-Octadecatrienoic acid, methyl ester
|
| Molecular Formula | C19H32O2 | |
| IUPAC Name* |
methyl (6E,9E,12E)-octadeca-6,9,12-trienoate
|
|
| SMILES |
CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)OC
|
|
| InChI |
InChI=1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11,13-14H,3-6,9,12,15-18H2,1-2H3/b8-7+,11-10+,14-13+
|
|
| InChIKey |
JFRWATCOFCPIBM-SPOHZTNBSA-N
|
|
| Synonyms |
6,9,12-Octadecatrienoic acid, methyl ester; LN4NQN66K8; methyl 6,9,12-octadecatrienoate; Methyl-6,9,12-octadecatrienoate; Methyl (6E,9E,12E)-octatrienoate; Methyl-(6E,9E,12E)-octadeca-6,9,12-trienoate; 6,9,12-Octadecatrienoic acid, methyl ester, (6E,9E,12E)-; 132029-21-1; Methyl -linolenate; 2676-41-7; 6,9,12-Octadecatrienoic acid methyl ester; UNII-LN4NQN66K8; SCHEMBL23143236; SCHEMBL23143237; GAMMA-LINOLENICACIDMETHYLESTER; AKOS015902233; Methyl (6E,9E,12E)-6,9,12-octadecatrienoate; J-010026; Methyl (6E,9E,12E)-6,9,12-octadecatrienoate #
|
|
| CAS | 132029-21-1 | |
| PubChem CID | 5362805 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 292.5 | ALogp: | 6.2 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 21 | QED Weighted: | 0.241 |
| Caco-2 Permeability: | -4.84 | MDCK Permeability: | 0.00004560 |
| Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.095 | 20% Bioavailability (F20%): | 0.948 |
| 30% Bioavailability (F30%): | 0.939 |
| Blood-Brain-Barrier Penetration (BBB): | 0.017 | Plasma Protein Binding (PPB): | 99.91% |
| Volume Distribution (VD): | 1.599 | Fu: | 1.08% |
| CYP1A2-inhibitor: | 0.912 | CYP1A2-substrate: | 0.269 |
| CYP2C19-inhibitor: | 0.682 | CYP2C19-substrate: | 0.063 |
| CYP2C9-inhibitor: | 0.703 | CYP2C9-substrate: | 0.979 |
| CYP2D6-inhibitor: | 0.683 | CYP2D6-substrate: | 0.76 |
| CYP3A4-inhibitor: | 0.856 | CYP3A4-substrate: | 0.086 |
| Clearance (CL): | 3.125 | Half-life (T1/2): | 0.876 |
| hERG Blockers: | 0.119 | Human Hepatotoxicity (H-HT): | 0.846 |
| Drug-inuced Liver Injury (DILI): | 0.015 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.951 |
| Skin Sensitization: | 0.97 | Carcinogencity: | 0.071 |
| Eye Corrosion: | 0.912 | Eye Irritation: | 0.933 |
| Respiratory Toxicity: | 0.425 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001605 | ![]() |
0.765 | D0UE9X | ![]() |
0.800 | ||
| ENC001660 | ![]() |
0.765 | D0O1TC | ![]() |
0.732 | ||
| ENC001714 | ![]() |
0.703 | D0G2MW | ![]() |
0.500 | ||
| ENC001711 | ![]() |
0.703 | D0OR6A | ![]() |
0.469 | ||
| ENC001094 | ![]() |
0.662 | D0O1PH | ![]() |
0.400 | ||
| ENC001645 | ![]() |
0.657 | D0Q5XX | ![]() |
0.387 | ||
| ENC001583 | ![]() |
0.640 | D09ANG | ![]() |
0.340 | ||
| ENC001435 | ![]() |
0.629 | D0H2YX | ![]() |
0.324 | ||
| ENC001549 | ![]() |
0.625 | D09SRR | ![]() |
0.298 | ||
| ENC001535 | ![]() |
0.603 | D0PS6X | ![]() |
0.291 | ||