|
Name |
Methyl linolelaidate
|
| Molecular Formula | C19H34O2 | |
| IUPAC Name* |
methyl (9E,12E)-octadeca-9,12-dienoate
|
|
| SMILES |
CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC
|
|
| InChI |
InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7+,11-10+
|
|
| InChIKey |
WTTJVINHCBCLGX-ZDVGBALWSA-N
|
|
| Synonyms |
Methyl linolelaidate; 2566-97-4; Methyl trans,trans-9,12-octadecadienoate; Methyl (9E,12E)-octadeca-9,12-dienoate; Linolelaidic acid, methyl ester; (9E,12E)-Methyl octadeca-9,12-dienoate; 2462-85-3; Methyl octadeca-9,12-dienoate; Linolelaidic acid-methyl ester; 9,12-Octadecadienoic acid, methyl ester, (E,E)-; JRB7ACQ5NW; Linoelaidic acid methyl ester; 9,12-Octadecadienoic acid, methyl ester, (9E,12E)-; (9E,12E)-9,12-Octadecadienoic acid methyl ester; TRANS-9,TRANS-12-OCTADECADIENOIC ACID METHYL ESTER; UNII-JRB7ACQ5NW; Linolelaidic acid methyl ester; UNII-11J6A3P924; 9,12-Octadecadienoic acid, methyl ester; EINECS 219-560-4; EINECS 219-901-7; methyl (9E,12Z)-octadeca-9,12-dienoate; MFCD00069997; AI3-36451; Linolelaidic Methyl Ester; 9,12-OCTADECADIENOIC ACID (Z,Z)-, METHYL ESTER, HYDROPEROXIDE; SCHEMBL813264; SCHEMBL813266; QSPL 074; SCHEMBL17191668; DTXSID90880893; 9,12-octadecadienoic acid methyl; CHEBI:143581; CAA56697; TRANS,TRANS-METHYL LINOLEATE; ZINC3875777; 9,12-Octadecadienoic acid (9Z,12Z)-, methyl ester, hydroperoxide; STL477115; AKOS015902997; 11J6A3P924; Methyl (E, E)-9,12-octadecadienoate; Methyl trans, trans-9,12-octadienoate; 9,12-Octadecadienoicacid, methyl ester; Methyl linolelaidate, analytical standard; 11068-03-4; METHYL (9E,12E)-OCTADECADIENOATE; Methyl 9-trans-12-trans-octadecadienoate; (9E,12E)-Methyloctadeca-9,12-dienoate; Methyl (9E,12E)-9,12-octadecadienoate; M2307; Methyl (9E,12E)-9,12-octadecadienoate #; Methyl linolelaidate, >=99% (GC), liquid; trans-9,12-Octadecadienoic acid methyl ester; (-)-trans-1,2-CyclohexanedicarboxylicAnhydride; T72179; trans-9,12-Octadecadienoic acid, methyl ester; 9,2-Octadecadienoic acid, methyl ester, (E,E)-; A902172; METHYL OCTADECA-TRANS-9-TRANS-12-DIENOATE; (9Z,12E)-9,12-Octadecadienoic acid methyl ester; J-016098; trans,trans-9,12-Octadecadienoic Acid Methyl Ester; trans,trans-octadeca-9,12-dienoic acid methyl ester; Q27281652
|
|
| CAS | 2566-97-4 | |
| PubChem CID | 5362793 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 294.5 | ALogp: | 6.9 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 21 | QED Weighted: | 0.222 |
| Caco-2 Permeability: | -4.796 | MDCK Permeability: | 0.00003170 |
| Pgp-inhibitor: | 0.02 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.043 | 20% Bioavailability (F20%): | 0.895 |
| 30% Bioavailability (F30%): | 0.988 |
| Blood-Brain-Barrier Penetration (BBB): | 0.146 | Plasma Protein Binding (PPB): | 99.87% |
| Volume Distribution (VD): | 3.059 | Fu: | 0.86% |
| CYP1A2-inhibitor: | 0.814 | CYP1A2-substrate: | 0.231 |
| CYP2C19-inhibitor: | 0.558 | CYP2C19-substrate: | 0.064 |
| CYP2C9-inhibitor: | 0.487 | CYP2C9-substrate: | 0.974 |
| CYP2D6-inhibitor: | 0.628 | CYP2D6-substrate: | 0.418 |
| CYP3A4-inhibitor: | 0.741 | CYP3A4-substrate: | 0.075 |
| Clearance (CL): | 3.484 | Half-life (T1/2): | 0.79 |
| hERG Blockers: | 0.174 | Human Hepatotoxicity (H-HT): | 0.278 |
| Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.83 |
| Skin Sensitization: | 0.966 | Carcinogencity: | 0.062 |
| Eye Corrosion: | 0.918 | Eye Irritation: | 0.951 |
| Respiratory Toxicity: | 0.72 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001605 | ![]() |
1.000 | D0O1TC | ![]() |
0.685 | ||
| ENC001714 | ![]() |
0.909 | D0UE9X | ![]() |
0.603 | ||
| ENC001645 | ![]() |
0.850 | D0OR6A | ![]() |
0.602 | ||
| ENC001435 | ![]() |
0.839 | D0O1PH | ![]() |
0.537 | ||
| ENC001583 | ![]() |
0.836 | D0H2YX | ![]() |
0.388 | ||
| ENC001535 | ![]() |
0.800 | D09ANG | ![]() |
0.381 | ||
| ENC001920 | ![]() |
0.800 | D0G2MW | ![]() |
0.372 | ||
| ENC002254 | ![]() |
0.791 | D07ILQ | ![]() |
0.364 | ||
| ENC001845 | ![]() |
0.767 | D09SRR | ![]() |
0.364 | ||
| ENC001661 | ![]() |
0.765 | D05ATI | ![]() |
0.354 | ||