![]() |
Name |
(2Z,6E)-Farnesal
|
Molecular Formula | C15H24O | |
IUPAC Name* |
(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienal
|
|
SMILES |
CC(=CCC/C(=C/CC/C(=C\C=O)/C)/C)C
|
|
InChI |
InChI=1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11-
|
|
InChIKey |
YHRUHBBTQZKMEX-PVMFERMNSA-N
|
|
Synonyms |
(2Z,6E)-Farnesal; (Z,E)-Farnesal; 2-cis-6-trans-Farnesal; cis,trans-Farnesal; Farnesal, (2Z,6E)-; 2E,6Z-farnesal; 4380-32-9; 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, (Z,E)-; FEMA No. 4019, (2Z,6E)-; W294Y02P00; 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, (2Z,6E)-; 3,7,11-trimethyldodeca-2Z,6E,10-trienal; cis-farnesal; UNII-W294Y02P00; Z,E-Farnesal; cis, trans-Farnesal; (2-cis,6-trans)-farnesal; (2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienal; SCHEMBL1301128; CHEBI:35968; ZINC13507228; LMPR0103010007; (2Z,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienal; Q27116654
|
|
CAS | 4380-32-9 | |
PubChem CID | 5365890 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.35 | ALogp: | 4.9 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 16 | QED Weighted: | 0.332 |
Caco-2 Permeability: | -4.351 | MDCK Permeability: | 0.00002500 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.787 |
30% Bioavailability (F30%): | 0.09 |
Blood-Brain-Barrier Penetration (BBB): | 0.723 | Plasma Protein Binding (PPB): | 98.98% |
Volume Distribution (VD): | 3.001 | Fu: | 2.17% |
CYP1A2-inhibitor: | 0.925 | CYP1A2-substrate: | 0.277 |
CYP2C19-inhibitor: | 0.541 | CYP2C19-substrate: | 0.819 |
CYP2C9-inhibitor: | 0.338 | CYP2C9-substrate: | 0.797 |
CYP2D6-inhibitor: | 0.372 | CYP2D6-substrate: | 0.177 |
CYP3A4-inhibitor: | 0.126 | CYP3A4-substrate: | 0.218 |
Clearance (CL): | 6.247 | Half-life (T1/2): | 0.482 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.978 |
Drug-inuced Liver Injury (DILI): | 0.128 | AMES Toxicity: | 0.201 |
Rat Oral Acute Toxicity: | 0.232 | Maximum Recommended Daily Dose: | 0.621 |
Skin Sensitization: | 0.951 | Carcinogencity: | 0.533 |
Eye Corrosion: | 0.677 | Eye Irritation: | 0.969 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002413 | ![]() |
1.000 | D05XQE | ![]() |
0.537 | ||
ENC001467 | ![]() |
0.702 | D09XWD | ![]() |
0.521 | ||
ENC001462 | ![]() |
0.686 | D03VFL | ![]() |
0.407 | ||
ENC001096 | ![]() |
0.686 | D0M1PQ | ![]() |
0.278 | ||
ENC001424 | ![]() |
0.674 | D01ZUA | ![]() |
0.207 | ||
ENC001434 | ![]() |
0.674 | D06BLQ | ![]() |
0.205 | ||
ENC001465 | ![]() |
0.621 | D0S7WX | ![]() |
0.176 | ||
ENC001464 | ![]() |
0.621 | D03ZFG | ![]() |
0.176 | ||
ENC001466 | ![]() |
0.621 | D0X7XG | ![]() |
0.174 | ||
ENC001716 | ![]() |
0.571 | D02DGU | ![]() |
0.172 |