|
Name |
Ethyl p-methoxycinnamate
|
| Molecular Formula | C12H14O3 | |
| IUPAC Name* |
ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate
|
|
| SMILES |
CCOC(=O)/C=C/C1=CC=C(C=C1)OC
|
|
| InChI |
InChI=1S/C12H14O3/c1-3-15-12(13)9-6-10-4-7-11(14-2)8-5-10/h4-9H,3H2,1-2H3/b9-6+
|
|
| InChIKey |
DHNGCHLFKUPGPX-RMKNXTFCSA-N
|
|
| Synonyms |
24393-56-4; Ethyl 4-Methoxycinnamate; Ethyl p-methoxycinnamate; 4-Methoxycinnamic Acid Ethyl Ester; 1929-30-2; (E)-Ethyl 3-(4-methoxyphenyl)acrylate; Ethyl 3-(4-methoxyphenyl)acrylate; Ethyl methoxycinnamate; Ethyl trans-p-methoxycinnamate; Solaboost SPF; ethyl trans-4-methoxycinnamate; Uvsob B; Ethyl (E)-4-methoxycinnamate; 4-Methoxy Ethyl Cinnamate; ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate; ethyl (2E)-3-(4-methoxyphenyl)prop-2-enoate; Ethyl (E)-p-methoxycinnamate; Ethyl 3-(4-methoxyphenyl)-2-propenoate; Ethyl (E)-3-(4-methoxyphenyl)-2-propenoate; Methyl-p-coumaric acid, ethyl ester; 3-(4-Methoxyphenyl)-2-propenoic acid, ethyl ester; 2-Propenoic acid, 3-(4-methoxyphenyl)-, ethyl ester; SD418S06XD; Ethyl (E)-3-(p-methoxyphenyl)-2-propenoate; 3-(Methoxyphenyl)-2-propenoic acid, ethyl ester; NSC636698; (2E)-3-(4-Methoxyphenyl)-2-propenoic acid ethyl ester; 2-Propenoic acid, 3-(4-methoxyphenyl)-, ethyl ester, (E)-; 2-Propenoic acid, 3-(4-methoxyphenyl)-, ethyl ester, (2E)-; ethyl (E)-3-(4-methoxyphenyl)acrylate; ETHYLP-METHOXYCINNAMATE; UNII-SD418S06XD; MFCD00026906; p-Methoxycinnamic acid ethyl ester; EINECS 217-679-6; EPMC; Ethyl4-methoxycinnamate; AI3-05527; ethyl para-methoxycinnamate; p-Methoxyl methyl cinnamate; SCHEMBL15190; (e)-ethyl-p-methoxycinnamate; CHEMBL95956; SCHEMBL1056347; Ethyl 4-methoxy-trans-cinnamate; Ethyl3-(4-methoxyphenyl)acrylate; DTXSID401308962; HMS3886P22; ZINC899863; ACT02259; BDBM50486903; ETHYL METHOXYCINNAMATE [INCI]; NSC 26462; NSC 44831; s9350; AKOS005070817; CCG-266623; NSC-636698; (E)-4-Methoxycinnamic acid ethyl ester; 4-Methoxybenzeneacrylic acid ethyl ester; trans-4-Methoxycinnamic acid ethyl ester; AC-29413; 3-(4-Methoxyphenyl)acrylic Acid Ethyl Ester; M1204; 3-(4-methoxy-phenyl)-acrylic acid ethyl ester; Ethyl (2E)-3-(4-methoxyphenyl)-2-propenoate; EN300-1453807; 6Z-0282; 880M645; A877939; A880299; Ethyl trans-4-methoxycinnamate, analytical standard; J-502027; Q-100958; Q27289147; Z53833826; (E)-3-(4-Methoxyphenyl)-2-propenoic acid ethyl ester
|
|
| CAS | 24393-56-4 | |
| PubChem CID | 5281783 | |
| ChEMBL ID | CHEMBL95956 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 206.24 | ALogp: | 3.0 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 35.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 15 | QED Weighted: | 0.561 |
| Caco-2 Permeability: | -4.447 | MDCK Permeability: | 0.00002020 |
| Pgp-inhibitor: | 0.107 | Pgp-substrate: | 0.07 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.968 |
| Blood-Brain-Barrier Penetration (BBB): | 0.935 | Plasma Protein Binding (PPB): | 89.54% |
| Volume Distribution (VD): | 0.822 | Fu: | 7.41% |
| CYP1A2-inhibitor: | 0.983 | CYP1A2-substrate: | 0.781 |
| CYP2C19-inhibitor: | 0.887 | CYP2C19-substrate: | 0.421 |
| CYP2C9-inhibitor: | 0.635 | CYP2C9-substrate: | 0.947 |
| CYP2D6-inhibitor: | 0.592 | CYP2D6-substrate: | 0.858 |
| CYP3A4-inhibitor: | 0.633 | CYP3A4-substrate: | 0.428 |
| Clearance (CL): | 10.026 | Half-life (T1/2): | 0.445 |
| hERG Blockers: | 0.081 | Human Hepatotoxicity (H-HT): | 0.047 |
| Drug-inuced Liver Injury (DILI): | 0.639 | AMES Toxicity: | 0.201 |
| Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.02 |
| Skin Sensitization: | 0.945 | Carcinogencity: | 0.663 |
| Eye Corrosion: | 0.641 | Eye Irritation: | 0.988 |
| Respiratory Toxicity: | 0.086 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001441 | ![]() |
0.660 | D0J5DC | ![]() |
0.417 | ||
| ENC001460 | ![]() |
0.587 | D0Q8ZX | ![]() |
0.364 | ||
| ENC000298 | ![]() |
0.471 | D02DPU | ![]() |
0.338 | ||
| ENC000201 | ![]() |
0.469 | D0C7AA | ![]() |
0.338 | ||
| ENC000785 | ![]() |
0.446 | D05CKR | ![]() |
0.324 | ||
| ENC000638 | ![]() |
0.434 | D0E6OC | ![]() |
0.313 | ||
| ENC000221 | ![]() |
0.426 | D0DJ1B | ![]() |
0.309 | ||
| ENC005495 | ![]() |
0.421 | D01ZJK | ![]() |
0.304 | ||
| ENC001420 | ![]() |
0.415 | D0VB0U | ![]() |
0.303 | ||
| ENC001676 | ![]() |
0.415 | D02HXS | ![]() |
0.299 | ||