|
Name |
Fallacinol
|
| Molecular Formula | C16H12O6 | |
| IUPAC Name* |
1,8-dihydroxy-3-(hydroxymethyl)-6-methoxyanthracene-9,10-dione
|
|
| SMILES |
COC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)CO
|
|
| InChI |
InChI=1S/C16H12O6/c1-22-8-4-10-14(12(19)5-8)16(21)13-9(15(10)20)2-7(6-17)3-11(13)18/h2-5,17-19H,6H2,1H3
|
|
| InChIKey |
WJXSYUJKJSOJOG-UHFFFAOYSA-N
|
|
| Synonyms |
Fallacinol; Teloschistin; 569-05-1; 1,8-dihydroxy-3-(hydroxymethyl)-6-methoxyanthracene-9,10-dione; Phallacinol; Chrysazin, 3-(hydroxymethyl)-6-methoxy-; SCHEMBL16225969; DTXSID80205430; CHEBI:144153; 1,8-Dihydroxy-3-(hydroxymethyl)-6-methoxy-9,10-anthracenedione; Anthraquinone, 1,8-dihydroxy-3-(hydroxymethyl)-6-methoxy-; 9,10-Anthracenedione, 1,8-dihydroxy-3-(hydroxymethyl)-6-methoxy-; NCGC00384926-01!1,8-dihydroxy-3-(hydroxymethyl)-6-methoxyanthracene-9,10-dione
|
|
| CAS | 569-05-1 | |
| PubChem CID | 3083633 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 300.26 | ALogp: | 1.8 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 104.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 22 | QED Weighted: | 0.667 |
| Caco-2 Permeability: | -5.255 | MDCK Permeability: | 0.00000463 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.649 | 20% Bioavailability (F20%): | 0.233 |
| 30% Bioavailability (F30%): | 0.998 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 93.83% |
| Volume Distribution (VD): | 0.52 | Fu: | 8.99% |
| CYP1A2-inhibitor: | 0.953 | CYP1A2-substrate: | 0.504 |
| CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.057 |
| CYP2C9-inhibitor: | 0.465 | CYP2C9-substrate: | 0.598 |
| CYP2D6-inhibitor: | 0.094 | CYP2D6-substrate: | 0.198 |
| CYP3A4-inhibitor: | 0.119 | CYP3A4-substrate: | 0.04 |
| Clearance (CL): | 5.98 | Half-life (T1/2): | 0.783 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.03 |
| Drug-inuced Liver Injury (DILI): | 0.713 | AMES Toxicity: | 0.483 |
| Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.911 |
| Skin Sensitization: | 0.921 | Carcinogencity: | 0.028 |
| Eye Corrosion: | 0.053 | Eye Irritation: | 0.934 |
| Respiratory Toxicity: | 0.789 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002229 | ![]() |
0.812 | D07MGA | ![]() |
0.330 | ||
| ENC001058 | ![]() |
0.773 | D0N1FS | ![]() |
0.304 | ||
| ENC000362 | ![]() |
0.773 | D0AZ8C | ![]() |
0.285 | ||
| ENC000913 | ![]() |
0.765 | D04AIT | ![]() |
0.283 | ||
| ENC005602 | ![]() |
0.739 | D06GCK | ![]() |
0.277 | ||
| ENC001971 | ![]() |
0.739 | D0K8KX | ![]() |
0.277 | ||
| ENC000966 | ![]() |
0.653 | D0R3JB | ![]() |
0.271 | ||
| ENC005227 | ![]() |
0.648 | D0C9XJ | ![]() |
0.258 | ||
| ENC000930 | ![]() |
0.648 | D07VLY | ![]() |
0.258 | ||
| ENC000336 | ![]() |
0.630 | D0U0OT | ![]() |
0.250 | ||