![]() |
Name |
1,2,8-Trihydroxy-6-methoxy-3-methylanthraquinone
|
Molecular Formula | C16H12O6 | |
IUPAC Name* |
1,2,8-trihydroxy-6-methoxy-3-methylanthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C(=C1O)O)C(=O)C3=C(C2=O)C=C(C=C3O)OC
|
|
InChI |
InChI=1S/C16H12O6/c1-6-3-8-12(16(21)13(6)18)15(20)11-9(14(8)19)4-7(22-2)5-10(11)17/h3-5,17-18,21H,1-2H3
|
|
InChIKey |
IOPGGNYCFGEWPF-UHFFFAOYSA-N
|
|
Synonyms |
6-O-methylalaternin; 1,2,8-Trihydroxy-6-methoxy-3-methylanthraquinone; C40SQV4QCZ; CHEMBL556684; 1,2,8-Trihydroxy-6-methoxy-3-methylanthracene-9,10-dione; 14717-90-9; UNII-C40SQV4QCZ; SCHEMBL16226377; DTXSID80163602; 9,10-Anthracenedione, 1,2,8-trihydroxy-6-methoxy-3-methyl-; BDBM50480483; 7-methoxy-2-methyl-3,4,5-trihydroxyanthraquinone; Q27275155; 3,4,5-TRIHYDROXY-7-METHOXY-2-METHYLANTHRAQUINONE; ANTHRAQUINONE, 1,2,8-TRIHYDROXY-6-METHOXY-3-METHYL-
|
|
CAS | 14717-90-9 | |
PubChem CID | 177458 | |
ChEMBL ID | CHEMBL556684 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 300.26 | ALogp: | 2.7 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.597 |
Caco-2 Permeability: | -5.125 | MDCK Permeability: | 0.00001230 |
Pgp-inhibitor: | 0.471 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.1 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.982 |
Blood-Brain-Barrier Penetration (BBB): | 0.006 | Plasma Protein Binding (PPB): | 99.37% |
Volume Distribution (VD): | 0.376 | Fu: | 3.95% |
CYP1A2-inhibitor: | 0.966 | CYP1A2-substrate: | 0.862 |
CYP2C19-inhibitor: | 0.116 | CYP2C19-substrate: | 0.068 |
CYP2C9-inhibitor: | 0.677 | CYP2C9-substrate: | 0.699 |
CYP2D6-inhibitor: | 0.512 | CYP2D6-substrate: | 0.267 |
CYP3A4-inhibitor: | 0.251 | CYP3A4-substrate: | 0.085 |
Clearance (CL): | 6.645 | Half-life (T1/2): | 0.567 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.23 |
Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.704 |
Rat Oral Acute Toxicity: | 0.398 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.919 | Carcinogencity: | 0.543 |
Eye Corrosion: | 0.019 | Eye Irritation: | 0.94 |
Respiratory Toxicity: | 0.181 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000336 | ![]() |
0.761 | D07MGA | ![]() |
0.319 | ||
ENC000362 | ![]() |
0.706 | D0N1FS | ![]() |
0.307 | ||
ENC005280 | ![]() |
0.697 | D06GCK | ![]() |
0.293 | ||
ENC002107 | ![]() |
0.686 | D01XWG | ![]() |
0.286 | ||
ENC005227 | ![]() |
0.681 | D0K8KX | ![]() |
0.280 | ||
ENC000930 | ![]() |
0.681 | D07VLY | ![]() |
0.279 | ||
ENC001497 | ![]() |
0.653 | D0C9XJ | ![]() |
0.279 | ||
ENC002229 | ![]() |
0.632 | D01XDL | ![]() |
0.266 | ||
ENC005542 | ![]() |
0.630 | D04AIT | ![]() |
0.258 | ||
ENC003228 | ![]() |
0.630 | D0AZ8C | ![]() |
0.256 |