![]() |
Name |
Meranzin
|
Molecular Formula | C15H16O4 | |
IUPAC Name* |
8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-7-methoxychromen-2-one
|
|
SMILES |
CC1([C@@H](O1)CC2=C(C=CC3=C2OC(=O)C=C3)OC)C
|
|
InChI |
InChI=1S/C15H16O4/c1-15(2)12(19-15)8-10-11(17-3)6-4-9-5-7-13(16)18-14(9)10/h4-7,12H,8H2,1-3H3/t12-/m0/s1
|
|
InChIKey |
LSZONYLDFHGRDP-LBPRGKRZSA-N
|
|
Synonyms |
Meranzin; 23971-42-8; 8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-7-methoxychromen-2-one; (-)-Meranzin; SCHEMBL14315527; HY-N3298; ZINC2154253; AC-34114; CS-0023841; Coumarin, 8-(2,3-epoxy-3-methylbutyl)-7-methoxy-, (-)-; 2H-1-Benzopyran-2-one, 8-[[(2S)-3,3-dimethyloxiranyl]methyl]-7-methoxy-; 2H-1-Benzopyran-2-one, 8-[(3,3-dimethyloxiranyl)methyl]-7-methoxy-, (S)-; 2H-1-Benzopyran-2-one, 8-[[(2S)-3,3-dimethyl-2-oxiranyl]methyl]-7-methoxy-
|
|
CAS | NA | |
PubChem CID | 1803558 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 260.28 | ALogp: | 2.5 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 48.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.627 |
Caco-2 Permeability: | -4.605 | MDCK Permeability: | 0.00002840 |
Pgp-inhibitor: | 0.115 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.974 |
Blood-Brain-Barrier Penetration (BBB): | 0.082 | Plasma Protein Binding (PPB): | 79.32% |
Volume Distribution (VD): | 0.901 | Fu: | 18.12% |
CYP1A2-inhibitor: | 0.932 | CYP1A2-substrate: | 0.949 |
CYP2C19-inhibitor: | 0.292 | CYP2C19-substrate: | 0.512 |
CYP2C9-inhibitor: | 0.156 | CYP2C9-substrate: | 0.701 |
CYP2D6-inhibitor: | 0.576 | CYP2D6-substrate: | 0.848 |
CYP3A4-inhibitor: | 0.141 | CYP3A4-substrate: | 0.383 |
Clearance (CL): | 11.847 | Half-life (T1/2): | 0.379 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.89 |
Drug-inuced Liver Injury (DILI): | 0.859 | AMES Toxicity: | 0.316 |
Rat Oral Acute Toxicity: | 0.157 | Maximum Recommended Daily Dose: | 0.682 |
Skin Sensitization: | 0.284 | Carcinogencity: | 0.905 |
Eye Corrosion: | 0.041 | Eye Irritation: | 0.07 |
Respiratory Toxicity: | 0.963 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001623 | ![]() |
0.412 | D08SKH | ![]() |
0.400 | ||
ENC001524 | ![]() |
0.409 | D08CCE | ![]() |
0.302 | ||
ENC001537 | ![]() |
0.400 | D05CKR | ![]() |
0.282 | ||
ENC002764 | ![]() |
0.379 | D0A0JH | ![]() |
0.269 | ||
ENC001562 | ![]() |
0.344 | D0DJ1B | ![]() |
0.269 | ||
ENC004351 | ![]() |
0.333 | D0FA2O | ![]() |
0.253 | ||
ENC005716 | ![]() |
0.329 | D0G4KG | ![]() |
0.250 | ||
ENC005717 | ![]() |
0.329 | D06GCK | ![]() |
0.247 | ||
ENC000078 | ![]() |
0.324 | D0E9CD | ![]() |
0.242 | ||
ENC004350 | ![]() |
0.324 | D07MGA | ![]() |
0.242 |