![]() |
Name |
(2R)-2-(3-Methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione
|
Molecular Formula | C15H16O2 | |
IUPAC Name* |
(2R)-2-(3-methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione
|
|
SMILES |
CC(=CC[C@@H]1CC(=O)C2=CC=CC=C2C1=O)C
|
|
InChI |
InChI=1S/C15H16O2/c1-10(2)7-8-11-9-14(16)12-5-3-4-6-13(12)15(11)17/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1
|
|
InChIKey |
CWIWSAPEOCRNMD-LLVKDONJSA-N
|
|
Synonyms |
58190-97-9; Catalponone; (2R)-Catalponone; (2R)-2-(3-Methylbut-2-enyl)-2,3-dihydronaphthalene-1,4-dione; DTXSID90973754; 2-(3-Methylbut-2-en-1-yl)-2,3-dihydronaphthalene-1,4-dione; 1,4-Naphthalenedione, 2,3-dihydro-2-(3-methyl-2-butenyl)-, (R)-
|
|
CAS | 58190-97-9 | |
PubChem CID | 181173 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 228.29 | ALogp: | 3.1 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 34.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.712 |
Caco-2 Permeability: | -4.682 | MDCK Permeability: | 0.00002470 |
Pgp-inhibitor: | 0.2 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.948 |
30% Bioavailability (F30%): | 0.987 |
Blood-Brain-Barrier Penetration (BBB): | 0.168 | Plasma Protein Binding (PPB): | 98.02% |
Volume Distribution (VD): | 2.691 | Fu: | 2.56% |
CYP1A2-inhibitor: | 0.981 | CYP1A2-substrate: | 0.434 |
CYP2C19-inhibitor: | 0.847 | CYP2C19-substrate: | 0.15 |
CYP2C9-inhibitor: | 0.589 | CYP2C9-substrate: | 0.848 |
CYP2D6-inhibitor: | 0.798 | CYP2D6-substrate: | 0.722 |
CYP3A4-inhibitor: | 0.282 | CYP3A4-substrate: | 0.141 |
Clearance (CL): | 18.236 | Half-life (T1/2): | 0.657 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.275 |
Drug-inuced Liver Injury (DILI): | 0.161 | AMES Toxicity: | 0.417 |
Rat Oral Acute Toxicity: | 0.356 | Maximum Recommended Daily Dose: | 0.486 |
Skin Sensitization: | 0.946 | Carcinogencity: | 0.411 |
Eye Corrosion: | 0.013 | Eye Irritation: | 0.954 |
Respiratory Toxicity: | 0.742 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000953 | ![]() |
0.593 | D03GET | ![]() |
0.383 | ||
ENC001031 | ![]() |
0.418 | D08FTG | ![]() |
0.352 | ||
ENC004792 | ![]() |
0.397 | D09WKB | ![]() |
0.347 | ||
ENC003357 | ![]() |
0.338 | D06BYV | ![]() |
0.323 | ||
ENC001926 | ![]() |
0.330 | D0U7GK | ![]() |
0.316 | ||
ENC003218 | ![]() |
0.330 | D08EOD | ![]() |
0.294 | ||
ENC006142 | ![]() |
0.328 | D05EPM | ![]() |
0.290 | ||
ENC005257 | ![]() |
0.325 | D07RGW | ![]() |
0.282 | ||
ENC001483 | ![]() |
0.316 | D08UMH | ![]() |
0.280 | ||
ENC001389 | ![]() |
0.309 | D0QL3P | ![]() |
0.278 |