|
Name |
N-prenyl-cyclo-L-tryptophyl-L-proline
|
| Molecular Formula | C21H25N3O2 | |
| IUPAC Name* |
(3S,8aS)-3-[[1-(3-methylbut-2-enyl)indol-3-yl]methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
| SMILES |
CC(=CCN1C=C(C2=CC=CC=C21)C[C@H]3C(=O)N4CCC[C@H]4C(=O)N3)C
|
|
| InChI |
InChI=1S/C21H25N3O2/c1-14(2)9-11-23-13-15(16-6-3-4-7-18(16)23)12-17-21(26)24-10-5-8-19(24)20(25)22-17/h3-4,6-7,9,13,17,19H,5,8,10-12H2,1-2H3,(H,22,25)/t17-,19-/m0/s1
|
|
| InChIKey |
UHDXIZKDEGWFRD-HKUYNNGSSA-N
|
|
| Synonyms |
N-prenyl-cyclo-L-tryptophyl-L-proline; (3S)-2,3,6,7,8,8aalpha-Hexahydro-3beta-[[1-(3-methyl-2-butenyl)-1H-indole-3-yl]methyl]pyrrolo[1,2-a]pyrazine-1,4-dione
|
|
| CAS | NA | |
| PubChem CID | 102011067 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 351.4 | ALogp: | 3.1 |
| HBD: | 1 | HBA: | 2 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 54.3 | Aromatic Rings: | 4 |
| Heavy Atoms: | 26 | QED Weighted: | 0.858 |
| Caco-2 Permeability: | -4.609 | MDCK Permeability: | 0.00001720 |
| Pgp-inhibitor: | 0.014 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.012 |
| 30% Bioavailability (F30%): | 0.05 |
| Blood-Brain-Barrier Penetration (BBB): | 0.55 | Plasma Protein Binding (PPB): | 89.56% |
| Volume Distribution (VD): | 1.009 | Fu: | 6.58% |
| CYP1A2-inhibitor: | 0.15 | CYP1A2-substrate: | 0.203 |
| CYP2C19-inhibitor: | 0.863 | CYP2C19-substrate: | 0.52 |
| CYP2C9-inhibitor: | 0.593 | CYP2C9-substrate: | 0.853 |
| CYP2D6-inhibitor: | 0.046 | CYP2D6-substrate: | 0.508 |
| CYP3A4-inhibitor: | 0.738 | CYP3A4-substrate: | 0.351 |
| Clearance (CL): | 11.063 | Half-life (T1/2): | 0.362 |
| hERG Blockers: | 0.076 | Human Hepatotoxicity (H-HT): | 0.973 |
| Drug-inuced Liver Injury (DILI): | 0.364 | AMES Toxicity: | 0.111 |
| Rat Oral Acute Toxicity: | 0.88 | Maximum Recommended Daily Dose: | 0.582 |
| Skin Sensitization: | 0.227 | Carcinogencity: | 0.863 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.068 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001926 | ![]() |
0.644 | D0K7WK | ![]() |
0.305 | ||
| ENC004610 | ![]() |
0.607 | D0RA9E | ![]() |
0.298 | ||
| ENC000975 | ![]() |
0.607 | D04ACW | ![]() |
0.297 | ||
| ENC003864 | ![]() |
0.565 | D06BCB | ![]() |
0.296 | ||
| ENC005484 | ![]() |
0.556 | D09ZIO | ![]() |
0.294 | ||
| ENC000825 | ![]() |
0.556 | D06GKN | ![]() |
0.292 | ||
| ENC001087 | ![]() |
0.556 | D02DMQ | ![]() |
0.288 | ||
| ENC005971 | ![]() |
0.556 | D08VRO | ![]() |
0.276 | ||
| ENC003217 | ![]() |
0.534 | D05EPM | ![]() |
0.275 | ||
| ENC004933 | ![]() |
0.531 | D0J5KF | ![]() |
0.273 | ||