|
Name |
Petasol
|
| Molecular Formula | C15H22O2 | |
| IUPAC Name* |
(3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one
|
|
| SMILES |
C[C@H]1[C@@H](CCC2=CC(=O)[C@@H](C[C@]12C)C(=C)C)O
|
|
| InChI |
InChI=1S/C15H22O2/c1-9(2)12-8-15(4)10(3)13(16)6-5-11(15)7-14(12)17/h7,10,12-13,16H,1,5-6,8H2,2-4H3/t10-,12-,13+,15+/m0/s1
|
|
| InChIKey |
AJFPOVBARCSOLH-MUYACECFSA-N
|
|
| Synonyms |
Petasol; Sencathenone; 64236-38-0; (+)-Petasol; P6AF873M8W; (3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one; 2(3H)-Naphthalenone, 4,4a,5,6,7,8-hexahydro-6-hydroxy-4a,5-dimethyl-3-(1-methylethenyl)-, (3S,4aR,5R,6R)-; UNII-P6AF873M8W; CHEMBL3581341; DTXSID70982783; 2(3H)-Naphthalenone, 4,4a,5,6,7,8-hexahydro-6-hydroxy-4a,5-dimethyl-3-(1-methylethenyl)-, (3S-(3alpha,4abeta,5beta,6alpha))-; Q27286286; 6-Hydroxy-4a,5-dimethyl-3-(prop-1-en-2-yl)-4,4a,5,6,7,8-hexahydronaphthalen-2(3H)-one; (3S,4aR,5R,6R)-6-hydroxy-3-isopropenyl-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one; 2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-6-HYDROXY-4A,5-DIMETHYL-3-(1-METHYLETHENYL)-, (3S-(3.ALPHA.,4A.BETA.,5.BETA.,6.ALPHA.))-
|
|
| CAS | 64236-38-0 | |
| PubChem CID | 5275907 | |
| ChEMBL ID | CHEMBL3581341 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 234.33 | ALogp: | 2.8 |
| HBD: | 1 | HBA: | 2 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 37.3 | Aromatic Rings: | 2 |
| Heavy Atoms: | 17 | QED Weighted: | 0.703 |
| Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00002250 |
| Pgp-inhibitor: | 0.464 | Pgp-substrate: | 0.283 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.026 |
| 30% Bioavailability (F30%): | 0.049 |
| Blood-Brain-Barrier Penetration (BBB): | 0.056 | Plasma Protein Binding (PPB): | 89.87% |
| Volume Distribution (VD): | 1.233 | Fu: | 10.91% |
| CYP1A2-inhibitor: | 0.709 | CYP1A2-substrate: | 0.881 |
| CYP2C19-inhibitor: | 0.357 | CYP2C19-substrate: | 0.907 |
| CYP2C9-inhibitor: | 0.088 | CYP2C9-substrate: | 0.703 |
| CYP2D6-inhibitor: | 0.372 | CYP2D6-substrate: | 0.521 |
| CYP3A4-inhibitor: | 0.096 | CYP3A4-substrate: | 0.592 |
| Clearance (CL): | 6.054 | Half-life (T1/2): | 0.783 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.417 |
| Drug-inuced Liver Injury (DILI): | 0.183 | AMES Toxicity: | 0.083 |
| Rat Oral Acute Toxicity: | 0.372 | Maximum Recommended Daily Dose: | 0.45 |
| Skin Sensitization: | 0.916 | Carcinogencity: | 0.713 |
| Eye Corrosion: | 0.159 | Eye Irritation: | 0.636 |
| Respiratory Toxicity: | 0.967 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002230 | ![]() |
0.574 | D04SFH | ![]() |
0.314 | ||
| ENC005061 | ![]() |
0.463 | D0KR5B | ![]() |
0.303 | ||
| ENC004127 | ![]() |
0.417 | D06XMU | ![]() |
0.300 | ||
| ENC005064 | ![]() |
0.409 | D07BSQ | ![]() |
0.298 | ||
| ENC001924 | ![]() |
0.387 | D0D2TN | ![]() |
0.297 | ||
| ENC001832 | ![]() |
0.387 | D0Z1XD | ![]() |
0.293 | ||
| ENC005063 | ![]() |
0.368 | D0I1LH | ![]() |
0.286 | ||
| ENC001829 | ![]() |
0.365 | D0CZ1Q | ![]() |
0.283 | ||
| ENC001437 | ![]() |
0.365 | D0L2LS | ![]() |
0.279 | ||
| ENC003665 | ![]() |
0.365 | D0CW1P | ![]() |
0.277 | ||