|
Name |
Flaviolin
|
| Molecular Formula | C10H6O5 | |
| IUPAC Name* |
4,5,7-trihydroxynaphthalene-1,2-dione
|
|
| SMILES |
C1=C(C=C(C2=C1C(=O)C(=O)C=C2O)O)O
|
|
| InChI |
InChI=1S/C10H6O5/c11-4-1-5-9(6(12)2-4)7(13)3-8(14)10(5)15/h1-3,11-13H
|
|
| InChIKey |
XNPCAGMCQDGQKK-UHFFFAOYSA-N
|
|
| Synonyms |
Flaviolin; 479-05-0; 4,5,7-trihydroxynaphthalene-1,2-dione; 2,5,7-TRIHYDROXYNAPHTHOQUINONE; CHEBI:42646; 1,4-Naphthalenedione, 2,5,7-trihydroxy-; TH7ZC8J7OE; 2,5,7-Trihydroxy-1,4-naphthalenedione; 2,5,7-trihydroxynaphthalene-1,4-dione; UNII-TH7ZC8J7OE; SCHEMBL703160; SCHEMBL2315695; CHEMBL1232770; DTXSID60963960; BDBM50487951; 2,5,7-trihydroxy-1,4-naphthoquinone; DB02521; C18012; Q27093505; 2,5,7-TRIHYDROXY-1,4-DIHYDRONAPHTHALENE-1,4-DIONE
|
|
| CAS | 479-05-0 | |
| PubChem CID | 160478 | |
| ChEMBL ID | CHEMBL1232770 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 206.15 | ALogp: | 0.7 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 94.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.554 |
| Caco-2 Permeability: | -4.699 | MDCK Permeability: | 0.00001290 |
| Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.038 | 20% Bioavailability (F20%): | 0.458 |
| 30% Bioavailability (F30%): | 0.964 |
| Blood-Brain-Barrier Penetration (BBB): | 0.047 | Plasma Protein Binding (PPB): | 78.77% |
| Volume Distribution (VD): | 0.78 | Fu: | 23.81% |
| CYP1A2-inhibitor: | 0.783 | CYP1A2-substrate: | 0.086 |
| CYP2C19-inhibitor: | 0.07 | CYP2C19-substrate: | 0.054 |
| CYP2C9-inhibitor: | 0.216 | CYP2C9-substrate: | 0.727 |
| CYP2D6-inhibitor: | 0.072 | CYP2D6-substrate: | 0.155 |
| CYP3A4-inhibitor: | 0.441 | CYP3A4-substrate: | 0.145 |
| Clearance (CL): | 12.869 | Half-life (T1/2): | 0.757 |
| hERG Blockers: | 0.071 | Human Hepatotoxicity (H-HT): | 0.039 |
| Drug-inuced Liver Injury (DILI): | 0.935 | AMES Toxicity: | 0.683 |
| Rat Oral Acute Toxicity: | 0.167 | Maximum Recommended Daily Dose: | 0.084 |
| Skin Sensitization: | 0.841 | Carcinogencity: | 0.107 |
| Eye Corrosion: | 0.318 | Eye Irritation: | 0.971 |
| Respiratory Toxicity: | 0.354 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002929 | ![]() |
0.531 | D07MGA | ![]() |
0.347 | ||
| ENC000094 | ![]() |
0.516 | D07EXH | ![]() |
0.333 | ||
| ENC002296 | ![]() |
0.516 | D04AIT | ![]() |
0.324 | ||
| ENC000335 | ![]() |
0.500 | D0K8KX | ![]() |
0.316 | ||
| ENC001058 | ![]() |
0.492 | D03GET | ![]() |
0.267 | ||
| ENC001929 | ![]() |
0.464 | D0R6BI | ![]() |
0.238 | ||
| ENC000935 | ![]() |
0.464 | D0Y7PG | ![]() |
0.237 | ||
| ENC005602 | ![]() |
0.449 | D08LFZ | ![]() |
0.236 | ||
| ENC001971 | ![]() |
0.449 | D0YF3X | ![]() |
0.235 | ||
| ENC002031 | ![]() |
0.448 | D00KRE | ![]() |
0.235 | ||