|
Name |
Versicolorin B
|
| Molecular Formula | C18H12O7 | |
| IUPAC Name* |
(4S,8R)-2,16,18-trihydroxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14(19),15,17-hexaene-13,20-dione
|
|
| SMILES |
C1CO[C@H]2[C@@H]1C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C4=O)C=C(C=C5O)O
|
|
| InChI |
InChI=1S/C18H12O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h3-5,7,18-20,23H,1-2H2/t7-,18+/m0/s1
|
|
| InChIKey |
BABJNKGTTYCTOO-ULCDLSAGSA-N
|
|
| Synonyms |
Versicolorin B; Versicolorin C; 4331-22-0; 6A6V34KGOC; 16049-49-3; W81KF41T35; Anthra(2,3-b)furo(3,2-d)furan-5,10-dione, 2,3,3a,12a-tetrahydro-4,6,8-trihydroxy-, (3aS,12aR)-; Anthra(2,3-b)furo(3,2-d)furan-5,10-dione, 2,3,3a,12a-tetrahydro-4,6,8-trihydroxy-, (3aR,12aS)-rel-; Anthra(2,3-b)furo(3,2-d)furan-5,10-dione, 2,3,3a,12a-tetrahydro-4,6,8-trihydroxy-, (3aS-cis)-; (3aS,12aR)-4,6,8-trihydroxy-2,3,3a,12a-tetrahydroanthra[2,3-b]furo[3,2-d]furan-5,10-dione; UNII-6A6V34KGOC; UNII-W81KF41T35; (4S,8R)-2,16,18-trihydroxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14(19),15,17-hexaene-13,20-dione; Anthra(2,3-b)furo(3,2-d)furan-5,10-dione, 2,3,3a,12a-tetrahydro-4,6,8-trihydroxy-, cis-(+-)-; (+/-)-VERSICOLORIN B; CHEMBL4744009; CHEBI:72674; DTXSID50936320; VERSICOLORIN B, (+/-)-; C20575; Q27140066; ANTHRA(2,3-B)FURO(3,2-D)FURAN-5,10-DIONE, 2,3,3A,12A-TETRAHYDRO-4,6,8-TRIHYDROXY-, CIS-(+/-)-; ANTHRA(2,3-B)FURO(3,2-D)FURAN-5,10-DIONE, 2,3,3A,12A-TETRAHYDRO-4,6,8-TRIHYDROXY-, CIS-(-)-; Anthra[2,3-b]furo[3,2-d]furan-5,10-dione, 2,3,3a,12a-tetrahydro-4,6,8-trihydroxy-, cis-(.+/-.)-
|
|
| CAS | 4331-22-0 | |
| PubChem CID | 107849 | |
| ChEMBL ID | CHEMBL4744009 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 340.3 | ALogp: | 2.3 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 113.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 25 | QED Weighted: | 0.576 |
| Caco-2 Permeability: | -5.309 | MDCK Permeability: | 0.00000761 |
| Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.714 | 20% Bioavailability (F20%): | 0.084 |
| 30% Bioavailability (F30%): | 0.989 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 93.80% |
| Volume Distribution (VD): | 0.555 | Fu: | 16.87% |
| CYP1A2-inhibitor: | 0.939 | CYP1A2-substrate: | 0.203 |
| CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.052 |
| CYP2C9-inhibitor: | 0.651 | CYP2C9-substrate: | 0.755 |
| CYP2D6-inhibitor: | 0.122 | CYP2D6-substrate: | 0.251 |
| CYP3A4-inhibitor: | 0.082 | CYP3A4-substrate: | 0.026 |
| Clearance (CL): | 8.217 | Half-life (T1/2): | 0.834 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.11 |
| Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.464 |
| Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.839 |
| Skin Sensitization: | 0.928 | Carcinogencity: | 0.405 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.897 |
| Respiratory Toxicity: | 0.139 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003823 | ![]() |
0.795 | D07MGA | ![]() |
0.337 | ||
| ENC002434 | ![]() |
0.659 | D0K8KX | ![]() |
0.300 | ||
| ENC001429 | ![]() |
0.629 | D0AZ8C | ![]() |
0.282 | ||
| ENC003182 | ![]() |
0.629 | D04AIT | ![]() |
0.280 | ||
| ENC004746 | ![]() |
0.618 | D01XDL | ![]() |
0.273 | ||
| ENC000864 | ![]() |
0.600 | D01XWG | ![]() |
0.272 | ||
| ENC000935 | ![]() |
0.541 | D0T8EH | ![]() |
0.266 | ||
| ENC000094 | ![]() |
0.531 | D07VLY | ![]() |
0.266 | ||
| ENC001058 | ![]() |
0.512 | D0C9XJ | ![]() |
0.266 | ||
| ENC004539 | ![]() |
0.510 | D01UBX | ![]() |
0.251 | ||