|
Name |
(1R,17R)-3,7,9-trihydroxy-17-methyl-16,18-dioxapentacyclo[15.2.2.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione
|
| Molecular Formula | C20H16O7 | |
| IUPAC Name* |
(1R,17R)-3,7,9-trihydroxy-17-methyl-16,18-dioxapentacyclo[15.2.2.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione
|
|
| SMILES |
C[C@@]12CC[C@@H](CO1)C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C4=O)C=C(C=C5O)O
|
|
| InChI |
InChI=1S/C20H16O7/c1-20-3-2-8(7-26-20)14-13(27-20)6-11-16(18(14)24)19(25)15-10(17(11)23)4-9(21)5-12(15)22/h4-6,8,21-22,24H,2-3,7H2,1H3/t8-,20+/m0/s1
|
|
| InChIKey |
VDUWMFOCSYSODX-FFVOIRBGSA-N
|
|
| Synonyms |
Paeciloquinone E
|
|
| CAS | NA | |
| PubChem CID | 101679484 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 368.3 | ALogp: | 2.8 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 113.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 27 | QED Weighted: | 0.557 |
| Caco-2 Permeability: | -5.189 | MDCK Permeability: | 0.00001140 |
| Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.868 | 20% Bioavailability (F20%): | 0.639 |
| 30% Bioavailability (F30%): | 0.995 |
| Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 97.29% |
| Volume Distribution (VD): | 0.513 | Fu: | 7.86% |
| CYP1A2-inhibitor: | 0.871 | CYP1A2-substrate: | 0.702 |
| CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.055 |
| CYP2C9-inhibitor: | 0.582 | CYP2C9-substrate: | 0.359 |
| CYP2D6-inhibitor: | 0.201 | CYP2D6-substrate: | 0.187 |
| CYP3A4-inhibitor: | 0.113 | CYP3A4-substrate: | 0.07 |
| Clearance (CL): | 9.714 | Half-life (T1/2): | 0.81 |
| hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.192 |
| Drug-inuced Liver Injury (DILI): | 0.932 | AMES Toxicity: | 0.687 |
| Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.914 |
| Skin Sensitization: | 0.952 | Carcinogencity: | 0.753 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.896 |
| Respiratory Toxicity: | 0.275 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001429 | ![]() |
0.765 | D07MGA | ![]() |
0.320 | ||
| ENC004746 | ![]() |
0.693 | D0K8KX | ![]() |
0.286 | ||
| ENC000843 | ![]() |
0.629 | D01XDL | ![]() |
0.281 | ||
| ENC004539 | ![]() |
0.628 | D01XWG | ![]() |
0.281 | ||
| ENC000864 | ![]() |
0.585 | D0C9XJ | ![]() |
0.275 | ||
| ENC003823 | ![]() |
0.543 | D07VLY | ![]() |
0.275 | ||
| ENC002439 | ![]() |
0.534 | D04AIT | ![]() |
0.267 | ||
| ENC002273 | ![]() |
0.529 | D0AZ8C | ![]() |
0.263 | ||
| ENC000935 | ![]() |
0.528 | D01UBX | ![]() |
0.258 | ||
| ENC000094 | ![]() |
0.518 | D0T8EH | ![]() |
0.258 | ||