![]() |
Name |
2,5-Cyclohexadien-1-one, 2,6-bis(1,1-dimethylethyl)-4-ethylidene-
|
Molecular Formula | C16H24O | |
IUPAC Name* |
2,6-ditert-butyl-4-ethylidenecyclohexa-2,5-dien-1-one
|
|
SMILES |
CC=C1C=C(C(=O)C(=C1)C(C)(C)C)C(C)(C)C
|
|
InChI |
InChI=1S/C16H24O/c1-8-11-9-12(15(2,3)4)14(17)13(10-11)16(5,6)7/h8-10H,1-7H3
|
|
InChIKey |
KEJPWCIDZLVYDJ-UHFFFAOYSA-N
|
|
Synonyms |
6738-27-8; 2,5-Cyclohexadien-1-one, 2,6-bis(1,1-dimethylethyl)-4-ethylidene-; 2,6-di-tert-butyl-4-ethylidenecyclohexa-2,5-dienone; 2,6-Di-tert-butyl-4-ethylidenecyclohexa-2,5-en-1-one; 2,5-Cyclohexadien-1-one, 2,6-di-tert-butyl-4-ethylidene-; 2,6-ditert-butyl-4-ethylidenecyclohexa-2,5-dien-1-one; 2,6-Bis(1,1-dimethylethyl)-4-ethylidene-2,5-cyclohexadiene-1-one; 56C43WA7V2; NSC-14452; NSC-87400; 2,6-Bis(1,1-dimethylethyl)-4-ethylidene-2,5-cyclohexadiene-1-on; 2, 2,6-di-tert-butyl-4-ethylidene-; 2, 2,6-bis(1,1-dimethylethyl)-4-ethylidene-; NSC 87400; 2,1-dimethylethyl)-4-ethylidene-2,5-cyclohexadiene-1-one; EINECS 229-795-4; NSC 14452; UNII-56C43WA7V2; SCHEMBL8676354; DTXSID5064465; 2,6-DI-TERT-BUTYL-4-ETHYLIDENECYCLOHEXA-2,5-DIEN-1-ONE; NSC14452; NSC87400; ZINC1653027; AB93071; 2,6-Di-tert-butyl-4-ethylidene-2,5-cyclohexadien-1-one; 2,6-Ditert-butyl-4-ethylidene-2,5-cyclohexadien-1-one #
|
|
CAS | 6738-27-8 | |
PubChem CID | 95039 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 232.36 | ALogp: | 4.8 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.576 |
Caco-2 Permeability: | -5.026 | MDCK Permeability: | 0.00000985 |
Pgp-inhibitor: | 0.953 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.187 | 20% Bioavailability (F20%): | 0.887 |
30% Bioavailability (F30%): | 0.958 |
Blood-Brain-Barrier Penetration (BBB): | 0.331 | Plasma Protein Binding (PPB): | 98.81% |
Volume Distribution (VD): | 4.925 | Fu: | 3.34% |
CYP1A2-inhibitor: | 0.931 | CYP1A2-substrate: | 0.939 |
CYP2C19-inhibitor: | 0.21 | CYP2C19-substrate: | 0.789 |
CYP2C9-inhibitor: | 0.494 | CYP2C9-substrate: | 0.891 |
CYP2D6-inhibitor: | 0.652 | CYP2D6-substrate: | 0.862 |
CYP3A4-inhibitor: | 0.348 | CYP3A4-substrate: | 0.546 |
Clearance (CL): | 4.877 | Half-life (T1/2): | 0.246 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.114 |
Drug-inuced Liver Injury (DILI): | 0.096 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.174 | Maximum Recommended Daily Dose: | 0.856 |
Skin Sensitization: | 0.842 | Carcinogencity: | 0.047 |
Eye Corrosion: | 0.928 | Eye Irritation: | 0.957 |
Respiratory Toxicity: | 0.801 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000452 | ![]() |
0.694 | D0W7WC | ![]() |
0.247 | ||
ENC000730 | ![]() |
0.566 | D01JFT | ![]() |
0.241 | ||
ENC000513 | ![]() |
0.566 | D0H2DQ | ![]() |
0.211 | ||
ENC001233 | ![]() |
0.462 | D0Y4DY | ![]() |
0.211 | ||
ENC001383 | ![]() |
0.456 | D06YPU | ![]() |
0.206 | ||
ENC000708 | ![]() |
0.387 | D00NJL | ![]() |
0.202 | ||
ENC000610 | ![]() |
0.383 | D09EBS | ![]() |
0.190 | ||
ENC000346 | ![]() |
0.383 | D07XYV | ![]() |
0.181 | ||
ENC000725 | ![]() |
0.361 | D0X4ZR | ![]() |
0.181 | ||
ENC000079 | ![]() |
0.361 | D0X5NX | ![]() |
0.176 |