|
Name |
2,5-Di-tert-butyl-1,4-benzoquinone
|
| Molecular Formula | C14H20O2 | |
| IUPAC Name* |
2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione
|
|
| SMILES |
CC(C)(C)C1=CC(=O)C(=CC1=O)C(C)(C)C
|
|
| InChI |
InChI=1S/C14H20O2/c1-13(2,3)9-7-12(16)10(8-11(9)15)14(4,5)6/h7-8H,1-6H3
|
|
| InChIKey |
ZZYASVWWDLJXIM-UHFFFAOYSA-N
|
|
| Synonyms |
2460-77-7; 2,5-Di-tert-butyl-1,4-benzoquinone; 2,5-di-tert-butylcyclohexa-2,5-diene-1,4-dione; 2,5-Di-tert-butyl-p-benzoquinone; 2,5-Di-tert-butylbenzoquinone; 2,5-Cyclohexadiene-1,4-dione, 2,5-bis(1,1-dimethylethyl)-; 2,5-Di-tert-butylquinone; 2,5-Di-tert-butylsemiquinone; 2,5-di-tert-Butyl-p-quinone; NSC 7489; 2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione; NSC 43579; p-Benzoquinone, 2,5-di-tert-butyl-; 2,5-DI-T-BUTYL-P-BENZOQUINONE; G893OSV02D; NSC-7489; NSC-43579; p-Benzoquinone,5-di-tert-butyl-; 2,4-dione, 2,5-bis(1,1-dimethylethyl)-; HSDB 3931; EINECS 219-552-0; BRN 2047945; UNII-G893OSV02D; AI3-16635; 2,5-Bis(1,1-dimethylethyl)-2,5-cyclohexadiene-1,4-dione; Maybridge4_002986; DSSTox_CID_24889; DSSTox_GSID_44889; SCHEMBL49783; 25-DBQ; CHEMBL3560130; DTXSID3044889; ZINC76106; ZZYASVWWDLJXIM-UHFFFAOYSA-; NSC7489; CHEBI:183272; 2,5-Cyclohexadien-1,4-dione, 2,5-bis(1,1-dimethylethyl)-; 2,5-di-tert-butyl-1,4-quinone; HMS1529H16; 2,5-di-t-butyl-1,4-benzoquinone; CCG-1811; NSC43579; Tox21_303738; 2,5-Ditert-butylbenzo-1,4-quinone; MFCD00019442; 2,5-ditert-butyl-[1,4]benzoquinone; AKOS015837828; CS-W023258; NCGC00176338-01; NCGC00176338-02; NCGC00357046-01; AS-15434; CAS-2460-77-7; 2,5-Di-tert-butyl-1,4-benzoquinone, 99%; D0178; FT-0610493; D71098; (2,5-Di-tert-butyl-1,4-phenylenebisoxy)radical; A817394; J-015589; Q27278928
|
|
| CAS | 2460-77-7 | |
| PubChem CID | 17161 | |
| ChEMBL ID | CHEMBL3560130 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 220.31 | ALogp: | 3.4 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 34.1 | Aromatic Rings: | 1 |
| Heavy Atoms: | 16 | QED Weighted: | 0.581 |
| Caco-2 Permeability: | -4.834 | MDCK Permeability: | 0.00001690 |
| Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.158 |
| 30% Bioavailability (F30%): | 0.029 |
| Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 93.16% |
| Volume Distribution (VD): | 1.924 | Fu: | 7.84% |
| CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.936 |
| CYP2C19-inhibitor: | 0.94 | CYP2C19-substrate: | 0.817 |
| CYP2C9-inhibitor: | 0.856 | CYP2C9-substrate: | 0.738 |
| CYP2D6-inhibitor: | 0.901 | CYP2D6-substrate: | 0.175 |
| CYP3A4-inhibitor: | 0.61 | CYP3A4-substrate: | 0.361 |
| Clearance (CL): | 3.033 | Half-life (T1/2): | 0.526 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.327 |
| Drug-inuced Liver Injury (DILI): | 0.244 | AMES Toxicity: | 0.099 |
| Rat Oral Acute Toxicity: | 0.704 | Maximum Recommended Daily Dose: | 0.756 |
| Skin Sensitization: | 0.935 | Carcinogencity: | 0.795 |
| Eye Corrosion: | 0.974 | Eye Irritation: | 0.974 |
| Respiratory Toxicity: | 0.918 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000452 | ![]() |
0.667 | D0W7WC | ![]() |
0.269 | ||
| ENC000730 | ![]() |
0.633 | D01JFT | ![]() |
0.250 | ||
| ENC000811 | ![]() |
0.566 | D0Y4DY | ![]() |
0.219 | ||
| ENC001233 | ![]() |
0.484 | D06YPU | ![]() |
0.215 | ||
| ENC001383 | ![]() |
0.481 | D00NJL | ![]() |
0.209 | ||
| ENC000708 | ![]() |
0.383 | D03GET | ![]() |
0.206 | ||
| ENC000725 | ![]() |
0.379 | D0H2DQ | ![]() |
0.206 | ||
| ENC000346 | ![]() |
0.379 | D09EBS | ![]() |
0.197 | ||
| ENC000079 | ![]() |
0.379 | D0ML1F | ![]() |
0.189 | ||
| ENC000610 | ![]() |
0.379 | D0X4ZR | ![]() |
0.188 | ||