![]() |
Name |
Thymol acetate
|
Molecular Formula | C12H16O2 | |
IUPAC Name* |
(5-methyl-2-propan-2-ylphenyl) acetate
|
|
SMILES |
CC1=CC(=C(C=C1)C(C)C)OC(=O)C
|
|
InChI |
InChI=1S/C12H16O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h5-8H,1-4H3
|
|
InChIKey |
WFMIUXMJJBBOGJ-UHFFFAOYSA-N
|
|
Synonyms |
Thymol acetate; Thymyl acetate; Acetylthymol; 528-79-0; O-Acetylthymol; Thymol, acetate; (5-methyl-2-propan-2-ylphenyl) acetate; Phenol, 5-methyl-2-(1-methylethyl)-, acetate; Phenol, 5-methyl-2-(1-methylethyl)-, 1-acetate; CHEBI:9583; 6I29126I5V; NSC-406522; Acetyl thymol; UNII-6I29126I5V; EINECS 208-442-8; NSC 406522; Thymol derivative, 17; AI3-03427; THYMOL ACETATE [MI]; SCHEMBL250091; CHEMBL3343661; DTXSID40862124; BDBM248169; HMS1728G14; ZINC899536; 2-Isopropyl-5-methylphenol acetate; NSC406522; 2-Isopropyl-5-methylphenyl acetate #; (2-isopropyl-5-methyl-phenyl) acetate; 5-methyl-2-(propan-2-yl)phenyl acetate; C09909; EN300-22486452; Q27108438
|
|
CAS | 528-79-0 | |
PubChem CID | 68252 | |
ChEMBL ID | CHEMBL3343661 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.25 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.525 |
Caco-2 Permeability: | -4.558 | MDCK Permeability: | 0.00002440 |
Pgp-inhibitor: | 0.084 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.907 |
30% Bioavailability (F30%): | 0.969 |
Blood-Brain-Barrier Penetration (BBB): | 0.991 | Plasma Protein Binding (PPB): | 89.96% |
Volume Distribution (VD): | 0.592 | Fu: | 20.39% |
CYP1A2-inhibitor: | 0.954 | CYP1A2-substrate: | 0.825 |
CYP2C19-inhibitor: | 0.774 | CYP2C19-substrate: | 0.85 |
CYP2C9-inhibitor: | 0.559 | CYP2C9-substrate: | 0.707 |
CYP2D6-inhibitor: | 0.236 | CYP2D6-substrate: | 0.68 |
CYP3A4-inhibitor: | 0.201 | CYP3A4-substrate: | 0.487 |
Clearance (CL): | 3.375 | Half-life (T1/2): | 0.51 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.01 |
Drug-inuced Liver Injury (DILI): | 0.629 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.031 |
Skin Sensitization: | 0.313 | Carcinogencity: | 0.528 |
Eye Corrosion: | 0.495 | Eye Irritation: | 0.974 |
Respiratory Toxicity: | 0.222 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000471 | ![]() |
0.683 | D06GIP | ![]() |
0.535 | ||
ENC000172 | ![]() |
0.391 | D05VIX | ![]() |
0.371 | ||
ENC000368 | ![]() |
0.391 | D0A3HB | ![]() |
0.340 | ||
ENC000365 | ![]() |
0.362 | D0GY5Z | ![]() |
0.333 | ||
ENC000199 | ![]() |
0.362 | D0L5FY | ![]() |
0.301 | ||
ENC001744 | ![]() |
0.358 | D01PJR | ![]() |
0.298 | ||
ENC000180 | ![]() |
0.356 | D0U9QU | ![]() |
0.293 | ||
ENC000347 | ![]() |
0.347 | D02EZM | ![]() |
0.290 | ||
ENC001823 | ![]() |
0.345 | D0WY5Q | ![]() |
0.288 | ||
ENC001821 | ![]() |
0.345 | D09GYT | ![]() |
0.283 |