![]() |
Name |
2-Isopropyl-5-methylanisole
|
Molecular Formula | C11H16O | |
IUPAC Name* |
2-methoxy-4-methyl-1-propan-2-ylbenzene
|
|
SMILES |
CC1=CC(=C(C=C1)C(C)C)OC
|
|
InChI |
InChI=1S/C11H16O/c1-8(2)10-6-5-9(3)7-11(10)12-4/h5-8H,1-4H3
|
|
InChIKey |
LSQXNMXDFRRDSJ-UHFFFAOYSA-N
|
|
Synonyms |
Thymol methyl ether; 1076-56-8; 2-Isopropyl-5-methylanisole; O-Methylthymol; Thymyl methyl ether; Methyl thymyl ether; 3-Methoxy-p-cymene; 4-Isopropyl-3-methoxytoluene; 1-Isopropyl-2-methoxy-4-methylbenzene; Methyl thymol ether; Benzene, 2-methoxy-4-methyl-1-(1-methylethyl)-; ANISOLE, 2-ISOPROPYL-5-METHYL-; 2-methoxy-4-methyl-1-propan-2-ylbenzene; 1-Methyl-3-methoxy-4-isopropylbenzene; methylthymol; FEMA No. 3436; Thymol methyl; Benzene,2-methoxy-4-methyl-1-(1-methylethyl)-; thymol Me ether; 2-methoxy-4-methyl-1-(propan-2-yl)benzene; 2-Methoxy-4-methyl-1-(1-methylethyl)benzene; Fema3436; VTE0C4390U; NSC-404221; Methylthymol, o-; EINECS 214-063-9; NSC 404221; BRN 2042889; UNII-VTE0C4390U; AI3-03431; thymyl methyl oxide; Methyl THYMYL oxide; starbld0009587; Thymol derivative, 21; DSSTox_CID_27617; DSSTox_RID_82455; DSSTox_GSID_47617; 4-06-00-03335 (Beilstein Handbook Reference); 3-METHOXY-PARA-CYMENE; SCHEMBL196752; 2-Isopropyl-5-methyl-Anisole; CHEMBL2424841; DTXSID5047617; CHEBI:167336; BDBM248170; ZINC1597137; Tox21_302575; MFCD01674973; NSC404221; 2-ISO PROPYL-5-METHYLANISOLE; AKOS015914183; Thymol methyl ether (= methyl thymol); NCGC00256877-01; LS-13985; CAS-1076-56-8; CS-0335474; FT-0754651; I0996; 1-Methyl-3-methoxy-4-isopropylbenzene, 98%; D91215; Q27292012; 1-METHYL-3-METHOXY-4-ISOPROPYL BENZENE [FHFI]; 1-Isopropyl-2-methoxy-4-methylbenzene, analytical standard
|
|
CAS | 1076-56-8 | |
PubChem CID | 14104 | |
ChEMBL ID | CHEMBL2424841 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 164.24 | ALogp: | 3.8 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 9.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.644 |
Caco-2 Permeability: | -4.406 | MDCK Permeability: | 0.00002200 |
Pgp-inhibitor: | 0.116 | Pgp-substrate: | 0.073 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.952 |
30% Bioavailability (F30%): | 0.955 |
Blood-Brain-Barrier Penetration (BBB): | 0.807 | Plasma Protein Binding (PPB): | 95.09% |
Volume Distribution (VD): | 2.204 | Fu: | 5.02% |
CYP1A2-inhibitor: | 0.942 | CYP1A2-substrate: | 0.956 |
CYP2C19-inhibitor: | 0.807 | CYP2C19-substrate: | 0.933 |
CYP2C9-inhibitor: | 0.438 | CYP2C9-substrate: | 0.788 |
CYP2D6-inhibitor: | 0.615 | CYP2D6-substrate: | 0.92 |
CYP3A4-inhibitor: | 0.227 | CYP3A4-substrate: | 0.628 |
Clearance (CL): | 8.538 | Half-life (T1/2): | 0.392 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.052 |
Drug-inuced Liver Injury (DILI): | 0.519 | AMES Toxicity: | 0.043 |
Rat Oral Acute Toxicity: | 0.063 | Maximum Recommended Daily Dose: | 0.052 |
Skin Sensitization: | 0.088 | Carcinogencity: | 0.468 |
Eye Corrosion: | 0.473 | Eye Irritation: | 0.977 |
Respiratory Toxicity: | 0.046 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000679 | ![]() |
0.683 | D06GIP | ![]() |
0.605 | ||
ENC000172 | ![]() |
0.553 | D09GYT | ![]() |
0.385 | ||
ENC000368 | ![]() |
0.439 | D0A3HB | ![]() |
0.375 | ||
ENC000199 | ![]() |
0.405 | D05VIX | ![]() |
0.333 | ||
ENC000365 | ![]() |
0.405 | D0E9CD | ![]() |
0.319 | ||
ENC000180 | ![]() |
0.400 | D02EZM | ![]() |
0.292 | ||
ENC000347 | ![]() |
0.386 | D0X0RI | ![]() |
0.288 | ||
ENC001821 | ![]() |
0.377 | D02XJY | ![]() |
0.286 | ||
ENC001822 | ![]() |
0.377 | D06IXT | ![]() |
0.279 | ||
ENC000498 | ![]() |
0.372 | D0U5CE | ![]() |
0.274 |