|
Name |
3',4'-Dimethoxyacetophenone
|
| Molecular Formula | C10H12O3 | |
| IUPAC Name* |
1-(3,4-dimethoxyphenyl)ethanone
|
|
| SMILES |
CC(=O)C1=CC(=C(C=C1)OC)OC
|
|
| InChI |
InChI=1S/C10H12O3/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h4-6H,1-3H3
|
|
| InChIKey |
IQZLUWLMQNGTIW-UHFFFAOYSA-N
|
|
| Synonyms |
1131-62-0; 3',4'-Dimethoxyacetophenone; 1-(3,4-Dimethoxyphenyl)ethanone; Acetoveratrone; 3,4-DIMETHOXYACETOPHENONE; Ethanone, 1-(3,4-dimethoxyphenyl)-; 3,4-Dimethoxyphenyl methyl ketone; 1-(3,4-Dimethoxyphenyl)ethan-1-one; Acetophenone, 3',4'-dimethoxy-; 4-Acetylveratrole; MFCD00008737; 5RV6436S8A; NSC-16944; NSC-18708; Acetophenone,4'-dimethoxy-; Ethanone,4-dimethoxyphenyl)-; NSC 18708; UNII-5RV6436S8A; EINECS 214-468-0; NSC 16944; AI3-11163; 3,4-dimethoxyphenylacetal; bmse010033; 3, 4-dimethoxyacetophenone; 3,4-dimethoxy acetophenone; SCHEMBL76834; 3',4'-dimethyoxyacetophenone; 3,'-4'-Dimethoxyacetophenone; CHEMBL4218890; DTXSID4061549; CHEBI:86576; 1-(3,4-dimethoxyphenyl)-ethanon; ZINC154459; 1-(3,4-dimethoxyphenyl)-ethanone; NSC16944; NSC18708; STR01828; 3?,4?-DIMETHOXYACETOPHENONE; 1-(3,4-Dimethoxy-phenyl)-ethanone; 1-(3,4-Dimethoxyphenyl)ethanone #; 3',4'-Dimethoxyacetophenone, 98%; AC7907; STK399977; 1-(3,4-dimethoxyphenyl)-1-ethanone; AKOS000120461; AM10708; CS-W005151; GF-0115; 3',4'-Dimethoxyacetophenone, >=98%; 1-(4,5-DIMETHOXYPHENYL)ETHANONE; AC-15467; SY015105; DB-041153; D1878; FT-0614336; EN300-16176; 3',4'-Dimethoxyacetophenone, analytical standard; 4'-Hydroxy-3'-methoxyacetophenone, methyl ether; A802955; AQ-917/40710349; Q222993; W-108624; 3',4'-Dimethoxyacetophenone, purum, >=97.0% (GC); Z54182939; F0191-0032; 3 inverted exclamation mark ,4 inverted exclamation mark -Dimethoxyacetophenone
|
|
| CAS | 1131-62-0 | |
| PubChem CID | 14328 | |
| ChEMBL ID | CHEMBL4218890 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 180.2 | ALogp: | 1.8 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 35.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 13 | QED Weighted: | 0.67 |
| Caco-2 Permeability: | -4.507 | MDCK Permeability: | 0.00002980 |
| Pgp-inhibitor: | 0.038 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.101 |
| Blood-Brain-Barrier Penetration (BBB): | 0.893 | Plasma Protein Binding (PPB): | 64.37% |
| Volume Distribution (VD): | 0.85 | Fu: | 30.06% |
| CYP1A2-inhibitor: | 0.966 | CYP1A2-substrate: | 0.953 |
| CYP2C19-inhibitor: | 0.677 | CYP2C19-substrate: | 0.845 |
| CYP2C9-inhibitor: | 0.094 | CYP2C9-substrate: | 0.829 |
| CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.895 |
| CYP3A4-inhibitor: | 0.07 | CYP3A4-substrate: | 0.448 |
| Clearance (CL): | 8.684 | Half-life (T1/2): | 0.879 |
| hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.076 |
| Drug-inuced Liver Injury (DILI): | 0.541 | AMES Toxicity: | 0.05 |
| Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.031 |
| Skin Sensitization: | 0.261 | Carcinogencity: | 0.25 |
| Eye Corrosion: | 0.548 | Eye Irritation: | 0.977 |
| Respiratory Toxicity: | 0.05 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000712 | ![]() |
0.750 | D09GYT | ![]() |
0.389 | ||
| ENC000499 | ![]() |
0.738 | D02XJY | ![]() |
0.377 | ||
| ENC000501 | ![]() |
0.585 | D0E6OC | ![]() |
0.360 | ||
| ENC001461 | ![]() |
0.543 | D0E9CD | ![]() |
0.354 | ||
| ENC001363 | ![]() |
0.529 | D0L0ZF | ![]() |
0.341 | ||
| ENC004830 | ![]() |
0.469 | D0VU8Q | ![]() |
0.341 | ||
| ENC000367 | ![]() |
0.469 | D06GCK | ![]() |
0.333 | ||
| ENC000296 | ![]() |
0.457 | D0M8VE | ![]() |
0.319 | ||
| ENC001055 | ![]() |
0.457 | D0Q9ON | ![]() |
0.316 | ||
| ENC001056 | ![]() |
0.457 | D0A8FB | ![]() |
0.314 | ||