|
Name |
Isoeugenyl methyl ether
|
| Molecular Formula | C11H14O2 | |
| IUPAC Name* |
1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene
|
|
| SMILES |
C/C=C\C1=CC(=C(C=C1)OC)OC
|
|
| InChI |
InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4-
|
|
| InChIKey |
NNWHUJCUHAELCL-PLNGDYQASA-N
|
|
| Synonyms |
6380-24-1; cis-Methylisoeugenol; cis-Methyl isoeugenol; Isoeugenyl methyl ether; Methylisoeugenol, (Z)-; cis-4-Propenyl veratrole; Methyl isoeugenol; (Z)-Methylisoeugenol; O-Methylisoeugenol; Isoeugenol methyl ether; (Z)-methyl isoeugenol; 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene; Benzene, 1,2-dimethoxy-4-(1-propenyl)-, (Z)-; 64DPK8DS6F; 1,3,4-Isoeugenol methyl ether; 4-Propenyl-1,2-dimethoxybenzene; Benzene, 1,2-dimethoxy-4-propenyl-, (Z)-; CHEBI:50550; 1-(3,4-Dimethoxyphenyl)-1-propene; NSC 46111; 1-Propene, 1-(3,4-dimethoxyphenyl)-; 1,2-dimethoxy-4-[(1Z)-prop-1-en-1-yl]benzene; 4-Propenyl veratrole; 1,2-DIMETHOXY-4-(1-PROPENYL)BENZENE; cis-isomethyleugenol; FEMA No. 2476; Benzene, 1,2-dimethoxy-4-(1-propen-1-yl)-; 3,4-Dimethoxypropenylbenzene (VAN); EINECS 202-224-6; UNII-64DPK8DS6F; BRN 0880472; UNII-46RN7Q97DE; 1,2-Dimethoxy-4-(1-propen-1-yl)benzene; AI3-20967; (e)-methyl eugenol; BRN 1911284; trans-Methyl isoeugenol; cis-isoeugenolmethylether; 4-(1-Propenyl)veratrole; cis-isoeugenol methyl ether; ghl.PD_Mitscher_leg0.375; 2-06-00-00918 (Beilstein Handbook Reference); 3-06-00-04995 (Beilstein Handbook Reference); (Z)-O-METHYLISOEUGENOL; 4-CIS-PROPENYLVERATROLE; 46RN7Q97DE; SCHEMBL1760676; CHEMBL1164609; FEMA 2476; DTXSID101026531; 1,2-Dimethoxy-4-propenyl-Benzene; FEMA NO. 2476, Z-; ZINC14680002; ISOEUGENYL METHYL ETHER, CIS-; 1,2-dimethoxy-4-cis-propenyl-benzene; AKOS025287899; VERATROLE, 4-PROPENYL-, CIS-; 1,2-Dimethoxy-4-propenyl-(E)-Benzene; 1,2-Dimethoxy-4-(1-propenyl)benzene, 9CI; (Z)-3,4-DIMETHOXY-.BETA.-METHYLSTYRENE; 1,2-DIMETHOXY-4-(1-CIS-PROPENYL)BENZENE; Q27122111; BENZENE, 1,2-DIMETHOXY-4-(1Z)-1-PROPEN-1-YL-
|
|
| CAS | 6380-24-1 | |
| PubChem CID | 1549045 | |
| ChEMBL ID | CHEMBL1164609 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 178.23 | ALogp: | 2.5 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 18.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 13 | QED Weighted: | 0.705 |
| Caco-2 Permeability: | -4.358 | MDCK Permeability: | 0.00002290 |
| Pgp-inhibitor: | 0.023 | Pgp-substrate: | 0.871 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.31 |
| Blood-Brain-Barrier Penetration (BBB): | 0.951 | Plasma Protein Binding (PPB): | 93.32% |
| Volume Distribution (VD): | 1.568 | Fu: | 6.38% |
| CYP1A2-inhibitor: | 0.981 | CYP1A2-substrate: | 0.949 |
| CYP2C19-inhibitor: | 0.551 | CYP2C19-substrate: | 0.879 |
| CYP2C9-inhibitor: | 0.072 | CYP2C9-substrate: | 0.241 |
| CYP2D6-inhibitor: | 0.068 | CYP2D6-substrate: | 0.743 |
| CYP3A4-inhibitor: | 0.319 | CYP3A4-substrate: | 0.571 |
| Clearance (CL): | 11.745 | Half-life (T1/2): | 0.845 |
| hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.419 |
| Drug-inuced Liver Injury (DILI): | 0.702 | AMES Toxicity: | 0.049 |
| Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.043 |
| Skin Sensitization: | 0.229 | Carcinogencity: | 0.585 |
| Eye Corrosion: | 0.195 | Eye Irritation: | 0.948 |
| Respiratory Toxicity: | 0.041 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000501 | ![]() |
0.571 | D0E6OC | ![]() |
0.431 | ||
| ENC000478 | ![]() |
0.543 | D0E9CD | ![]() |
0.404 | ||
| ENC001446 | ![]() |
0.517 | D0F4ZY | ![]() |
0.395 | ||
| ENC000712 | ![]() |
0.511 | D09GYT | ![]() |
0.382 | ||
| ENC000499 | ![]() |
0.510 | D06GCK | ![]() |
0.313 | ||
| ENC001577 | ![]() |
0.510 | D0Q9ON | ![]() |
0.312 | ||
| ENC001410 | ![]() |
0.510 | D02XJY | ![]() |
0.308 | ||
| ENC002396 | ![]() |
0.477 | D01SAT | ![]() |
0.305 | ||
| ENC001460 | ![]() |
0.457 | D0NJ3V | ![]() |
0.305 | ||
| ENC001363 | ![]() |
0.436 | D01FFA | ![]() |
0.279 | ||