|
Name |
Estragole
|
| Molecular Formula | C10H12O | |
| IUPAC Name* |
1-methoxy-4-prop-2-enylbenzene
|
|
| SMILES |
COC1=CC=C(C=C1)CC=C
|
|
| InChI |
InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3,5-8H,1,4H2,2H3
|
|
| InChIKey |
ZFMSMUAANRJZFM-UHFFFAOYSA-N
|
|
| Synonyms |
Estragole; 4-Allylanisole; 140-67-0; 1-Allyl-4-methoxybenzene; p-Allylanisole; Methyl chavicol; Tarragon; Chavicol methyl ether; Esdragol; Esdragole; Estragol; Anisole, p-allyl-; Esdragon; Isoanethole; 4-Methoxyallylbenzene; Terragon; Benzene, 1-methoxy-4-(2-propenyl)-; p-Methoxyallylbenzene; 1-methoxy-4-prop-2-enylbenzene; 4-Allylmethoxybenzene; 4-Allyl-1-methoxybenzene; Methylchavicol; p-Allylmethoxybenzene; Chavicyl methyl ether; Chavicol, O-methyl-; 1-METHOXY-4-(2-PROPENYL)BENZENE; 3-(p-Methoxyphenyl)propene; 1-allyl-4-methoxy-benzene; FEMA No. 2411; Methyl chavicole; NCI-C60946; MFCD00008653; 1-Methoxy-4-(2-propen-1-yl)benzene; NSC 404113; 3-(4-Methoxyphenyl)-1-propene; 1-methoxy-4-(2-propenyl)-benzene; p-Allylphenyl methyl ether; Ether, p-allylphenyl methyl; 9NIW07V3ET; Benzene, 1-methoxy-4-(2-propen-1-yl)-; CHEBI:4867; Benzene, 1-methoxy, 4-prop-2-enyl; NSC-404113; 1-methoxy-4-(prop-2-en-1-yl)benzene; DSSTox_CID_575; DSSTox_RID_75667; DSSTox_GSID_20575; Estragole (natural); FEMA Number 2411; Allylphenyl methyl ether, p-; CAS-140-67-0; CCRIS 1317; HSDB 5412; EINECS 205-427-8; UNII-9NIW07V3ET; EPA Pesticide Chemical Code 062150; BRN 1099454; Isoanthethole; Esteragol; Methyl-Chavicol; AI3-16052; 4-allylanisol; para-allylanisole; p-Allyl-Anisole; Chavicol, methyl-; O-Methyl-Chavicol; p-methoxy allylbenzene; 4-methoxy allylbenzene; ESTRAGOLE [FCC]; 4-Allylanisole, 98%; ESTRAGOLE [MI]; ESTRAGOLE [FHFI]; Estragol (methylchavicol); Methyl chavicole (estragole); SCHEMBL57204; 4-06-00-03817 (Beilstein Handbook Reference); MLS001065575; Para-allylanisole (estragole); Estragole, analytical standard; SPECTRUM1505117; WLN: 1U2R DO1; CHEMBL470671; DTXSID0020575; AUSTL 21320; FEMA 2411; 4-Allylanisole, >=98%, FCC; HMS2268E24; ZINC967635; 4-Allylanisole, analytical standard; HY-N5060; Tox21_202387; Tox21_302930; NSC404113; s5339; 1 -Methoxy-4-(2-propenyl) benzene; AKOS000121300; CCG-214642; 1-Methoxy-4-(2-propen-1-yl)-Benzene; 1-Methoxy-4-(2-propenyl)benzene, 9CI; NCGC00091434-01; NCGC00091434-02; NCGC00091434-03; NCGC00256481-01; NCGC00259936-01; AS-35303; SMR000112379; 4-Allylanisole, purum, >=97.0% (GC); A0702; CS-0032231; FT-0617414; EN300-21676; 1-METHOXY-4-(2-PROPENYL)BENZENE [HSDB]; BENZENE,1-ALLYL,4-METHOXY METHYLCHAVICOL; Q419495; SR-01000838348; BENZENE,1-ALLYL,4-METHOXY METHYLCHAVICOL; J-007415; SR-01000838348-2; p-allylanisole, 4-allyl-1-methoxybenzene, methyl chavicol; 1407-27-8; 77525-18-9
|
|
| CAS | 140-67-0 | |
| PubChem CID | 8815 | |
| ChEMBL ID | CHEMBL470671 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 148.2 | ALogp: | 3.4 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 9.2 | Aromatic Rings: | 1 |
| Heavy Atoms: | 11 | QED Weighted: | 0.598 |
| Caco-2 Permeability: | -4.308 | MDCK Permeability: | 0.00002750 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.056 |
| 30% Bioavailability (F30%): | 0.472 |
| Blood-Brain-Barrier Penetration (BBB): | 0.659 | Plasma Protein Binding (PPB): | 91.35% |
| Volume Distribution (VD): | 1.054 | Fu: | 2.44% |
| CYP1A2-inhibitor: | 0.967 | CYP1A2-substrate: | 0.946 |
| CYP2C19-inhibitor: | 0.941 | CYP2C19-substrate: | 0.752 |
| CYP2C9-inhibitor: | 0.545 | CYP2C9-substrate: | 0.864 |
| CYP2D6-inhibitor: | 0.842 | CYP2D6-substrate: | 0.927 |
| CYP3A4-inhibitor: | 0.441 | CYP3A4-substrate: | 0.498 |
| Clearance (CL): | 12.054 | Half-life (T1/2): | 0.577 |
| hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.065 |
| Drug-inuced Liver Injury (DILI): | 0.055 | AMES Toxicity: | 0.142 |
| Rat Oral Acute Toxicity: | 0.031 | Maximum Recommended Daily Dose: | 0.188 |
| Skin Sensitization: | 0.877 | Carcinogencity: | 0.738 |
| Eye Corrosion: | 0.755 | Eye Irritation: | 0.984 |
| Respiratory Toxicity: | 0.109 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000223 | ![]() |
0.639 | D05CKR | ![]() |
0.339 | ||
| ENC000676 | ![]() |
0.595 | D02HXS | ![]() |
0.333 | ||
| ENC000638 | ![]() |
0.585 | D02DPU | ![]() |
0.333 | ||
| ENC000318 | ![]() |
0.514 | D08JZS | ![]() |
0.329 | ||
| ENC000221 | ![]() |
0.514 | D0W1RY | ![]() |
0.319 | ||
| ENC005495 | ![]() |
0.489 | D0I2MK | ![]() |
0.313 | ||
| ENC000095 | ![]() |
0.488 | D0Q1IT | ![]() |
0.312 | ||
| ENC001052 | ![]() |
0.488 | D04KJO | ![]() |
0.312 | ||
| ENC001460 | ![]() |
0.476 | D0D1DI | ![]() |
0.312 | ||
| ENC000201 | ![]() |
0.452 | D06CDO | ![]() |
0.306 | ||