![]() |
Name |
Dipropyl phthalate
|
Molecular Formula | C14H18O4 | |
IUPAC Name* |
dipropyl benzene-1,2-dicarboxylate
|
|
SMILES |
CCCOC(=O)C1=CC=CC=C1C(=O)OCCC
|
|
InChI |
InChI=1S/C14H18O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h5-8H,3-4,9-10H2,1-2H3
|
|
InChIKey |
MQHNKCZKNAJROC-UHFFFAOYSA-N
|
|
Synonyms |
Dipropyl phthalate; 131-16-8; Di-n-propylphthalate; DI-N-PROPYL PHTHALATE; dipropyl benzene-1,2-dicarboxylate; Phthalic acid, dipropyl ester; 1,2-Benzenedicarboxylic acid, dipropyl ester; Phthalic Acid Dipropyl Ester; Phthalic acid di-n-propyl ester; CHEBI:60069; 1,2-benzenedicarboxylic acid dipropyl ester; 1,2-Benzenedicarboxylic acid, 1,2-dipropyl ester; 8USP5Y77SS; 4-09-00-03174 (Beilstein Handbook Reference); NSC 15314;Di-n-Propyl phthalate; NSC-15314; Dipropylphthalate; DSSTox_CID_11133; DSSTox_RID_78865; DSSTox_GSID_31133; N-Dipropyl phthalate; CAS-131-16-8; EINECS 205-015-8; NSC 15314; UNII-8USP5Y77SS; BRN 2332522; AI3-01767; Dipropyl phtalate; phthalic acid, bis-propyl ester; 1, dipropyl ester; Phthalic acid dipropyl; Dipropyl phthalate, 98%; Epitope ID:138713; MLS002222366; BIDD:ER0350; SCHEMBL112063; CHEMBL1483029; DTXSID5031133; Phthalic acid, di-n-propyl ester; HMS3039L17; NSC15314; ZINC1706878; Tox21_201662; Tox21_303379; MFCD00009371; AKOS015838979; NCGC00090783-01; NCGC00090783-02; NCGC00090783-03; NCGC00257273-01; NCGC00259211-01; BS-15188; SMR001307293; DB-042007; CS-0014049; FT-0625198; P0306; D94471; DIPROPYL ESTER1,2-BENZENEDICARBOXYLIC ACID; J-005947; Dipropyl phthalate, PESTANAL(R), analytical standard; Q27127053
|
|
CAS | 131-16-8 | |
PubChem CID | 8559 | |
ChEMBL ID | CHEMBL1483029 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 250.29 | ALogp: | 4.0 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.724 |
Caco-2 Permeability: | -4.356 | MDCK Permeability: | 0.00003180 |
Pgp-inhibitor: | 0.139 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.993 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.061 | Plasma Protein Binding (PPB): | 85.64% |
Volume Distribution (VD): | 0.982 | Fu: | 6.26% |
CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.555 |
CYP2C19-inhibitor: | 0.935 | CYP2C19-substrate: | 0.07 |
CYP2C9-inhibitor: | 0.792 | CYP2C9-substrate: | 0.335 |
CYP2D6-inhibitor: | 0.291 | CYP2D6-substrate: | 0.177 |
CYP3A4-inhibitor: | 0.188 | CYP3A4-substrate: | 0.13 |
Clearance (CL): | 13.074 | Half-life (T1/2): | 0.337 |
hERG Blockers: | 0.228 | Human Hepatotoxicity (H-HT): | 0.005 |
Drug-inuced Liver Injury (DILI): | 0.317 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.003 |
Skin Sensitization: | 0.393 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.024 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.024 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000090 | ![]() |
0.767 | D0N6CR | ![]() |
0.367 | ||
ENC000154 | ![]() |
0.679 | D0GY5Z | ![]() |
0.349 | ||
ENC001800 | ![]() |
0.676 | D07NAJ | ![]() |
0.338 | ||
ENC000586 | ![]() |
0.667 | D0Q7ZG | ![]() |
0.333 | ||
ENC000669 | ![]() |
0.639 | D0TZ1G | ![]() |
0.329 | ||
ENC000158 | ![]() |
0.625 | D0I2WV | ![]() |
0.323 | ||
ENC000157 | ![]() |
0.603 | D08JIV | ![]() |
0.323 | ||
ENC000301 | ![]() |
0.593 | D0K8CI | ![]() |
0.316 | ||
ENC000164 | ![]() |
0.590 | D05KON | ![]() |
0.311 | ||
ENC001801 | ![]() |
0.560 | D0G2MH | ![]() |
0.309 |