|
Name |
Dihydroegotamine
|
| Molecular Formula | C33H37N5O5 | |
| IUPAC Name* |
N-(7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide
|
|
| SMILES |
CC1(C(=O)N2C(C(=O)N3CCCC3C2(O1)O)CC4=CC=CC=C4)NC(=O)C5CC6C(CC7=CNC8=CC=CC6=C78)N(C5)C
|
|
| InChI |
InChI=1S/C33H37N5O5/c1-32(35-29(39)21-15-23-22-10-6-11-24-28(22)20(17-34-24)16-25(23)36(2)18-21)31(41)38-26(14-19-8-4-3-5-9-19)30(40)37-13-7-12-27(37)33(38,42)43-32/h3-6,8-11,17,21,23,25-27,34,42H,7,12-16,18H2,1-2H3,(H,35,39)
|
|
| InChIKey |
LUZRJRNZXALNLM-UHFFFAOYSA-N
|
|
| Synonyms |
Dihydroegotamine; Dehydroergotamine; Ergotamine, 9,10-dihydro-; DHE; DHE 45; SCHEMBL10123876; BDBM86235; CHEBI:91758; CAS_3066; NSC_3066; AKOS015962151; L000730; BRD-A54845972-066-01-5; 5'-Benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxo-9,10-dihydroergotaman #; Ergotaman-3',6',18-trione, 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'.alpha.,10.alpha.)-; Ergotaman-3',6',18-trione, 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'.alpha.,10.alpha.)-, monomethanesulfonate; N-(7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide
|
|
| CAS | NA | |
| PubChem CID | 3066 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 583.7 | ALogp: | 2.4 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 118.0 | Aromatic Rings: | 8 |
| Heavy Atoms: | 43 | QED Weighted: | 0.435 |
| Caco-2 Permeability: | -5.07 | MDCK Permeability: | 0.00002280 |
| Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.456 | 20% Bioavailability (F20%): | 0.083 |
| 30% Bioavailability (F30%): | 0.992 |
| Blood-Brain-Barrier Penetration (BBB): | 0.818 | Plasma Protein Binding (PPB): | 90.90% |
| Volume Distribution (VD): | 3.528 | Fu: | 7.64% |
| CYP1A2-inhibitor: | 0.008 | CYP1A2-substrate: | 0.209 |
| CYP2C19-inhibitor: | 0.477 | CYP2C19-substrate: | 0.933 |
| CYP2C9-inhibitor: | 0.843 | CYP2C9-substrate: | 0.72 |
| CYP2D6-inhibitor: | 0.044 | CYP2D6-substrate: | 0.288 |
| CYP3A4-inhibitor: | 0.952 | CYP3A4-substrate: | 0.962 |
| Clearance (CL): | 16.491 | Half-life (T1/2): | 0.494 |
| hERG Blockers: | 0.125 | Human Hepatotoxicity (H-HT): | 0.167 |
| Drug-inuced Liver Injury (DILI): | 0.84 | AMES Toxicity: | 0.014 |
| Rat Oral Acute Toxicity: | 0.823 | Maximum Recommended Daily Dose: | 0.947 |
| Skin Sensitization: | 0.137 | Carcinogencity: | 0.876 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0.058 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005471 | ![]() |
0.385 | D0V3ZA | ![]() |
1.000 | ||
| ENC004971 | ![]() |
0.367 | D0SP3D | ![]() |
0.925 | ||
| ENC003591 | ![]() |
0.351 | D09NNH | ![]() |
0.873 | ||
| ENC001635 | ![]() |
0.321 | D01TSI | ![]() |
0.745 | ||
| ENC002408 | ![]() |
0.321 | D02IQY | ![]() |
0.624 | ||
| ENC005997 | ![]() |
0.318 | D06YFA | ![]() |
0.424 | ||
| ENC001985 | ![]() |
0.309 | D0UA0I | ![]() |
0.400 | ||
| ENC002042 | ![]() |
0.305 | D04EGX | ![]() |
0.309 | ||
| ENC004609 | ![]() |
0.301 | D04JCN | ![]() |
0.308 | ||
| ENC004458 | ![]() |
0.301 | D02DMQ | ![]() |
0.297 | ||