![]() |
Name |
13-dehydroxycyclotryprostatin C
|
Molecular Formula | C21H23N3O3 | |
IUPAC Name* |
(1R,12S,15S)-1-hydroxy-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione
|
|
SMILES |
CC(=C[C@H]1C2=C(C[C@@]3(N1C(=O)[C@@H]4CCCN4C3=O)O)C5=CC=CC=C5N2)C
|
|
InChI |
InChI=1S/C21H23N3O3/c1-12(2)10-17-18-14(13-6-3-4-7-15(13)22-18)11-21(27)20(26)23-9-5-8-16(23)19(25)24(17)21/h3-4,6-7,10,16-17,22,27H,5,8-9,11H2,1-2H3/t16-,17-,21+/m0/s1
|
|
InChIKey |
YFEPEUHYAAENPV-XGHQBKJUSA-N
|
|
Synonyms |
13-dehydroxycyclotryprostatin C
|
|
CAS | NA | |
PubChem CID | 163184267 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 365.4 | ALogp: | 2.2 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.6 | Aromatic Rings: | 5 |
Heavy Atoms: | 27 | QED Weighted: | 0.763 |
Caco-2 Permeability: | -4.788 | MDCK Permeability: | 0.00001310 |
Pgp-inhibitor: | 0.555 | Pgp-substrate: | 0.573 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.898 |
Blood-Brain-Barrier Penetration (BBB): | 0.854 | Plasma Protein Binding (PPB): | 89.04% |
Volume Distribution (VD): | 0.836 | Fu: | 8.06% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.163 |
CYP2C19-inhibitor: | 0.808 | CYP2C19-substrate: | 0.848 |
CYP2C9-inhibitor: | 0.887 | CYP2C9-substrate: | 0.874 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.123 |
CYP3A4-inhibitor: | 0.792 | CYP3A4-substrate: | 0.94 |
Clearance (CL): | 6.758 | Half-life (T1/2): | 0.454 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.847 |
Drug-inuced Liver Injury (DILI): | 0.989 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.895 | Maximum Recommended Daily Dose: | 0.814 |
Skin Sensitization: | 0.409 | Carcinogencity: | 0.626 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002042 | ![]() |
0.730 | D0U7GP | ![]() |
0.348 | ||
ENC002064 | ![]() |
0.730 | D01JGV | ![]() |
0.348 | ||
ENC003264 | ![]() |
0.559 | D0H4JM | ![]() |
0.348 | ||
ENC001958 | ![]() |
0.559 | D05MQK | ![]() |
0.345 | ||
ENC003265 | ![]() |
0.543 | D01TSI | ![]() |
0.309 | ||
ENC002274 | ![]() |
0.520 | D06YFA | ![]() |
0.309 | ||
ENC001060 | ![]() |
0.520 | D08VRO | ![]() |
0.303 | ||
ENC004694 | ![]() |
0.488 | D0V3ZA | ![]() |
0.301 | ||
ENC002980 | ![]() |
0.488 | D09NNH | ![]() |
0.291 | ||
ENC004695 | ![]() |
0.488 | D02IQY | ![]() |
0.283 |