![]() |
Name |
Guignardone V
|
Molecular Formula | C16H20O5 | |
IUPAC Name* |
7-acetyl-12-hydroxy-4-methyl-3,14-dioxatetracyclo[10.2.1.02,10.04,8]pentadec-2(10)-en-11-one
|
|
SMILES |
CC(=O)C1CCC2(C)OC3=C(CC12)C(=O)C1(O)COC3C1
|
|
InChI |
InChI=1S/C16H20O5/c1-8(17)9-3-4-15(2)11(9)5-10-13(21-15)12-6-16(19,7-20-12)14(10)18/h9,11-12,19H,3-7H2,1-2H3/t9-,11-,12-,15+,16+/m0/s1
|
|
InChIKey |
QPUANSSRWQEYEB-JMHSHNQBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 292.33 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 21 | QED Weighted: | 0.794 |
Caco-2 Permeability: | -4.797 | MDCK Permeability: | 0.00001900 |
Pgp-inhibitor: | 0.034 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.695 | Plasma Protein Binding (PPB): | 65.89% |
Volume Distribution (VD): | 0.805 | Fu: | 36.04% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.862 |
CYP2C19-inhibitor: | 0.049 | CYP2C19-substrate: | 0.832 |
CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.155 |
CYP3A4-inhibitor: | 0.026 | CYP3A4-substrate: | 0.761 |
Clearance (CL): | 11.594 | Half-life (T1/2): | 0.313 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.707 |
Drug-inuced Liver Injury (DILI): | 0.685 | AMES Toxicity: | 0.051 |
Rat Oral Acute Toxicity: | 0.746 | Maximum Recommended Daily Dose: | 0.739 |
Skin Sensitization: | 0.438 | Carcinogencity: | 0.562 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002719 | ![]() |
0.841 | D0C7JF | ![]() |
0.290 | ||
ENC003341 | ![]() |
0.764 | D04SFH | ![]() |
0.273 | ||
ENC002720 | ![]() |
0.686 | D04GJN | ![]() |
0.273 | ||
ENC006126 | ![]() |
0.671 | D0Q4SD | ![]() |
0.268 | ||
ENC002721 | ![]() |
0.634 | D06AEO | ![]() |
0.265 | ||
ENC003340 | ![]() |
0.595 | D0I2SD | ![]() |
0.260 | ||
ENC003657 | ![]() |
0.595 | D07BSQ | ![]() |
0.258 | ||
ENC006129 | ![]() |
0.558 | D0F1UL | ![]() |
0.258 | ||
ENC003344 | ![]() |
0.519 | D0U3GL | ![]() |
0.253 | ||
ENC003594 | ![]() |
0.455 | D0IL7L | ![]() |
0.252 |