![]() |
Name |
Guignardone C
|
Molecular Formula | C17H22O4 | |
IUPAC Name* |
(1R,4R,7R,8S,12S)-1-hydroxy-4-methyl-7-prop-1-en-2-yl-3,13-dioxatetracyclo[10.2.1.02,10.04,8]pentadec-2(10)-en-11-one
|
|
SMILES |
CC(=C)[C@@H]1CC[C@@]2([C@H]1CC3=C(O2)[C@]4(C[C@@H](C3=O)OC4)O)C
|
|
InChI |
InChI=1S/C17H22O4/c1-9(2)10-4-5-16(3)12(10)6-11-14(18)13-7-17(19,8-20-13)15(11)21-16/h10,12-13,19H,1,4-8H2,2-3H3/t10-,12-,13-,16+,17+/m0/s1
|
|
InChIKey |
DJBBHFCWBSNKEG-AWKHGQQRSA-N
|
|
Synonyms |
Guignardone C; CHEMBL3609687
|
|
CAS | NA | |
PubChem CID | 50905844 | |
ChEMBL ID | CHEMBL3609687 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.4 | ALogp: | 1.6 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 21 | QED Weighted: | 0.754 |
Caco-2 Permeability: | -4.785 | MDCK Permeability: | 0.00001720 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.072 |
Blood-Brain-Barrier Penetration (BBB): | 0.449 | Plasma Protein Binding (PPB): | 74.90% |
Volume Distribution (VD): | 1.477 | Fu: | 18.47% |
CYP1A2-inhibitor: | 0.078 | CYP1A2-substrate: | 0.772 |
CYP2C19-inhibitor: | 0.161 | CYP2C19-substrate: | 0.824 |
CYP2C9-inhibitor: | 0.059 | CYP2C9-substrate: | 0.056 |
CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.182 |
CYP3A4-inhibitor: | 0.207 | CYP3A4-substrate: | 0.532 |
Clearance (CL): | 4.537 | Half-life (T1/2): | 0.215 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.637 |
Drug-inuced Liver Injury (DILI): | 0.85 | AMES Toxicity: | 0.588 |
Rat Oral Acute Toxicity: | 0.274 | Maximum Recommended Daily Dose: | 0.676 |
Skin Sensitization: | 0.212 | Carcinogencity: | 0.808 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.101 |
Respiratory Toxicity: | 0.338 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002719 | ![]() |
0.758 | D0C7JF | ![]() |
0.277 | ||
ENC006127 | ![]() |
0.634 | D0U3GL | ![]() |
0.253 | ||
ENC003341 | ![]() |
0.588 | D04GJN | ![]() |
0.248 | ||
ENC003344 | ![]() |
0.539 | D0Q4SD | ![]() |
0.246 | ||
ENC003594 | ![]() |
0.534 | D0W3OS | ![]() |
0.245 | ||
ENC003340 | ![]() |
0.532 | D0A2AJ | ![]() |
0.241 | ||
ENC006126 | ![]() |
0.517 | D06AEO | ![]() |
0.240 | ||
ENC003343 | ![]() |
0.513 | D0D2VS | ![]() |
0.240 | ||
ENC003339 | ![]() |
0.513 | D04SFH | ![]() |
0.235 | ||
ENC002720 | ![]() |
0.513 | D0I2SD | ![]() |
0.235 |