![]() |
Name |
asperpyrone
|
Molecular Formula | C14H10O7 | |
IUPAC Name* |
2-(2-carboxy-3-hydroxyphenyl)-5-methyl-6-oxopyran-3-carboxylicacid
|
|
SMILES |
Cc1cc(C(=O)O)c(-c2cccc(O)c2C(=O)O)oc1=O
|
|
InChI |
InChI=1S/C14H10O7/c1-6-5-8(12(16)17)11(21-14(6)20)7-3-2-4-9(15)10(7)13(18)19/h2-5,15H,1H3,(H,16,17)(H,18,19)
|
|
InChIKey |
BRURYVZJSBEMPL-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.23 | ALogp: | 1.7 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 125.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.791 |
Caco-2 Permeability: | -5.845 | MDCK Permeability: | 0.00000810 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.08 |
Human Intestinal Absorption (HIA): | 0.024 | 20% Bioavailability (F20%): | 0.074 |
30% Bioavailability (F30%): | 0.97 |
Blood-Brain-Barrier Penetration (BBB): | 0.053 | Plasma Protein Binding (PPB): | 87.62% |
Volume Distribution (VD): | 0.465 | Fu: | 7.19% |
CYP1A2-inhibitor: | 0.082 | CYP1A2-substrate: | 0.052 |
CYP2C19-inhibitor: | 0.044 | CYP2C19-substrate: | 0.034 |
CYP2C9-inhibitor: | 0.214 | CYP2C9-substrate: | 0.047 |
CYP2D6-inhibitor: | 0.029 | CYP2D6-substrate: | 0.067 |
CYP3A4-inhibitor: | 0.05 | CYP3A4-substrate: | 0.02 |
Clearance (CL): | 0.868 | Half-life (T1/2): | 0.896 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.904 |
Drug-inuced Liver Injury (DILI): | 0.994 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.002 |
Skin Sensitization: | 0.341 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.41 |
Respiratory Toxicity: | 0.459 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002472 | ![]() |
0.481 | D00KRE | ![]() |
0.349 | ||
ENC002362 | ![]() |
0.474 | D07HBX | ![]() |
0.339 | ||
ENC004765 | ![]() |
0.474 | D0H2ZW | ![]() |
0.315 | ||
ENC004131 | ![]() |
0.444 | D0Y0JH | ![]() |
0.313 | ||
ENC000390 | ![]() |
0.441 | D08LFZ | ![]() |
0.313 | ||
ENC005347 | ![]() |
0.423 | D01WJL | ![]() |
0.308 | ||
ENC003644 | ![]() |
0.410 | D0C4YC | ![]() |
0.308 | ||
ENC005677 | ![]() |
0.402 | D0G5UB | ![]() |
0.303 | ||
ENC002148 | ![]() |
0.381 | D0N1FS | ![]() |
0.303 | ||
ENC005416 | ![]() |
0.379 | D0GY5Z | ![]() |
0.300 |