![]() |
Name |
pinophicin A
|
Molecular Formula | C20H28O4 | |
IUPAC Name* |
5-hydroxy-3,14-dimethyl-6-oxo-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(11),12-diene-8-carboxylicacid
|
|
SMILES |
CC(C)C1=C2CCC(C(=O)O)C3=C(CC2(C)CC1)C(C)C(O)C3=O
|
|
InChI |
InChI=1S/C20H28O4/c1-10(2)12-7-8-20(4)9-14-11(3)17(21)18(22)16(14)13(19(23)24)5-6-15(12)20/h10-11,13,17,21H,5-9H2,1-4H3,(H,23,24)/t11-,13+,17-,20-/m0/s1
|
|
InChIKey |
QEXHNWJNYGYTKI-UYVAFLIISA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 332.44 | ALogp: | 3.5 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.742 |
Caco-2 Permeability: | -5.152 | MDCK Permeability: | 0.00003220 |
Pgp-inhibitor: | 0.031 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.534 | Plasma Protein Binding (PPB): | 97.13% |
Volume Distribution (VD): | 0.619 | Fu: | 1.27% |
CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.754 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.882 |
CYP2C9-inhibitor: | 0.084 | CYP2C9-substrate: | 0.891 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.188 |
CYP3A4-inhibitor: | 0.051 | CYP3A4-substrate: | 0.273 |
Clearance (CL): | 1.435 | Half-life (T1/2): | 0.246 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.217 |
Drug-inuced Liver Injury (DILI): | 0.759 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.495 | Maximum Recommended Daily Dose: | 0.063 |
Skin Sensitization: | 0.034 | Carcinogencity: | 0.153 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.03 |
Respiratory Toxicity: | 0.357 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002032 | ![]() |
0.416 | D01CKY | ![]() |
0.291 | ||
ENC004252 | ![]() |
0.344 | D04ATM | ![]() |
0.279 | ||
ENC003168 | ![]() |
0.308 | D04SFH | ![]() |
0.257 | ||
ENC004664 | ![]() |
0.291 | D0IX6I | ![]() |
0.250 | ||
ENC005116 | ![]() |
0.291 | D0F2AK | ![]() |
0.248 | ||
ENC003555 | ![]() |
0.291 | D04GJN | ![]() |
0.245 | ||
ENC004004 | ![]() |
0.287 | D0I2SD | ![]() |
0.245 | ||
ENC002423 | ![]() |
0.287 | D0KR5B | ![]() |
0.239 | ||
ENC002195 | ![]() |
0.282 | D0IL7L | ![]() |
0.239 | ||
ENC001817 | ![]() |
0.280 | D0P0HT | ![]() |
0.236 |