![]() |
Name |
2-(12S-hydroxypropyl)-3-hydroxy-methyl-6-hydroxy-7-methoxychromone
|
Molecular Formula | C15H18O5 | |
IUPAC Name* |
6-hydroxy-3-(hydroxymethyl)-7-methoxy-2-(2-methylpropyl)chromen-4-one
|
|
SMILES |
COc1cc2oc(CC(C)C)c(CO)c(=O)c2cc1O
|
|
InChI |
InChI=1S/C15H18O5/c1-8(2)4-12-10(7-16)15(18)9-5-11(17)14(19-3)6-13(9)20-12/h5-6,8,16-17H,4,7H2,1-3H3
|
|
InChIKey |
MIVGBBFKEZUTPD-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.3 | ALogp: | 2.2 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.9 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.898 |
Caco-2 Permeability: | -4.708 | MDCK Permeability: | 0.00001290 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.799 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.011 |
Blood-Brain-Barrier Penetration (BBB): | 0.311 | Plasma Protein Binding (PPB): | 88.24% |
Volume Distribution (VD): | 0.817 | Fu: | 18.38% |
CYP1A2-inhibitor: | 0.937 | CYP1A2-substrate: | 0.93 |
CYP2C19-inhibitor: | 0.182 | CYP2C19-substrate: | 0.468 |
CYP2C9-inhibitor: | 0.463 | CYP2C9-substrate: | 0.848 |
CYP2D6-inhibitor: | 0.232 | CYP2D6-substrate: | 0.601 |
CYP3A4-inhibitor: | 0.157 | CYP3A4-substrate: | 0.206 |
Clearance (CL): | 6.874 | Half-life (T1/2): | 0.903 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.644 |
Drug-inuced Liver Injury (DILI): | 0.883 | AMES Toxicity: | 0.538 |
Rat Oral Acute Toxicity: | 0.157 | Maximum Recommended Daily Dose: | 0.316 |
Skin Sensitization: | 0.453 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.201 |
Respiratory Toxicity: | 0.243 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005902 | ![]() |
0.493 | D06GCK | ![]() |
0.295 | ||
ENC003860 | ![]() |
0.487 | D0QD1G | ![]() |
0.290 | ||
ENC002207 | ![]() |
0.471 | D0G5UB | ![]() |
0.281 | ||
ENC004732 | ![]() |
0.471 | D07MGA | ![]() |
0.278 | ||
ENC002335 | ![]() |
0.449 | D0U5CE | ![]() |
0.264 | ||
ENC002878 | ![]() |
0.419 | D03LGG | ![]() |
0.264 | ||
ENC004502 | ![]() |
0.417 | D09PJX | ![]() |
0.255 | ||
ENC005361 | ![]() |
0.416 | D0E9CD | ![]() |
0.254 | ||
ENC001773 | ![]() |
0.416 | D0O6KE | ![]() |
0.250 | ||
ENC003466 | ![]() |
0.408 | D04UTT | ![]() |
0.245 |