![]() |
Name |
Phomopsichin D
|
Molecular Formula | C15H16O7 | |
IUPAC Name* |
methyl 7-hydroxy-3-(hydroxymethyl)-2-[(2S)-2-hydroxypropyl]-4-oxochromene-5-carboxylate
|
|
SMILES |
C[C@@H](CC1=C(C(=O)C2=C(C=C(C=C2O1)O)C(=O)OC)CO)O
|
|
InChI |
InChI=1S/C15H16O7/c1-7(17)3-11-10(6-16)14(19)13-9(15(20)21-2)4-8(18)5-12(13)22-11/h4-5,7,16-18H,3,6H2,1-2H3/t7-/m0/s1
|
|
InChIKey |
AJFJHVAIVJZVEW-ZETCQYMHSA-N
|
|
Synonyms |
Phomopsichin D
|
|
CAS | NA | |
PubChem CID | 139590407 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 308.28 | ALogp: | 0.7 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 22 | QED Weighted: | 0.724 |
Caco-2 Permeability: | -5.029 | MDCK Permeability: | 0.00003720 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.752 |
Human Intestinal Absorption (HIA): | 0.072 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.801 |
Blood-Brain-Barrier Penetration (BBB): | 0.21 | Plasma Protein Binding (PPB): | 64.01% |
Volume Distribution (VD): | 1.055 | Fu: | 40.63% |
CYP1A2-inhibitor: | 0.831 | CYP1A2-substrate: | 0.825 |
CYP2C19-inhibitor: | 0.059 | CYP2C19-substrate: | 0.09 |
CYP2C9-inhibitor: | 0.122 | CYP2C9-substrate: | 0.729 |
CYP2D6-inhibitor: | 0.033 | CYP2D6-substrate: | 0.308 |
CYP3A4-inhibitor: | 0.074 | CYP3A4-substrate: | 0.115 |
Clearance (CL): | 7.13 | Half-life (T1/2): | 0.954 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.355 |
Drug-inuced Liver Injury (DILI): | 0.829 | AMES Toxicity: | 0.248 |
Rat Oral Acute Toxicity: | 0.007 | Maximum Recommended Daily Dose: | 0.609 |
Skin Sensitization: | 0.248 | Carcinogencity: | 0.017 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.076 |
Respiratory Toxicity: | 0.342 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004949 | ![]() |
0.595 | D0G5UB | ![]() |
0.280 | ||
ENC002690 | ![]() |
0.544 | D0K8KX | ![]() |
0.280 | ||
ENC003547 | ![]() |
0.538 | D04AIT | ![]() |
0.272 | ||
ENC002462 | ![]() |
0.506 | D0QD1G | ![]() |
0.254 | ||
ENC004951 | ![]() |
0.500 | D0O6KE | ![]() |
0.250 | ||
ENC005902 | ![]() |
0.500 | D04UTT | ![]() |
0.245 | ||
ENC004950 | ![]() |
0.500 | D06GCK | ![]() |
0.243 | ||
ENC006026 | ![]() |
0.487 | D02UFG | ![]() |
0.238 | ||
ENC005904 | ![]() |
0.478 | D0U0OT | ![]() |
0.238 | ||
ENC003857 | ![]() |
0.470 | D0Z3DY | ![]() |
0.237 |