|
Name |
mollicellin X
|
| Molecular Formula | C22H21ClO8 | |
| IUPAC Name* |
8-chloro-4,9-dihydroxy-3-methoxy-1,7-dimethyl-2-(3-methylbutanoyl)-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde
|
|
| SMILES |
COc1c(O)c2c(c(C)c1C(=O)CC(C)C)Oc1c(C=O)c(O)c(Cl)c(C)c1C(=O)O2
|
|
| InChI |
InChI=1S/C22H21ClO8/c1-8(2)6-12(25)13-10(4)18-21(17(27)20(13)29-5)31-22(28)14-9(3)15(23)16(26)11(7-24)19(14)30-18/h7-8,26-27H,6H2,1-5H3
|
|
| InChIKey |
AQSRALJCIBXGQA-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 448.86 | ALogp: | 4.7 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 119.4 | Aromatic Rings: | 3 |
| Heavy Atoms: | 31 | QED Weighted: | 0.278 |
| Caco-2 Permeability: | -4.97 | MDCK Permeability: | 0.00002070 |
| Pgp-inhibitor: | 0.106 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.489 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0 |
| Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 99.93% |
| Volume Distribution (VD): | 0.676 | Fu: | 1.48% |
| CYP1A2-inhibitor: | 0.225 | CYP1A2-substrate: | 0.218 |
| CYP2C19-inhibitor: | 0.437 | CYP2C19-substrate: | 0.468 |
| CYP2C9-inhibitor: | 0.887 | CYP2C9-substrate: | 0.888 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.174 |
| CYP3A4-inhibitor: | 0.151 | CYP3A4-substrate: | 0.151 |
| Clearance (CL): | 1.169 | Half-life (T1/2): | 0.248 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.014 |
| Drug-inuced Liver Injury (DILI): | 0.493 | AMES Toxicity: | 0.078 |
| Rat Oral Acute Toxicity: | 0.996 | Maximum Recommended Daily Dose: | 0.915 |
| Skin Sensitization: | 0.735 | Carcinogencity: | 0.076 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.938 |
| Respiratory Toxicity: | 0.48 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005960 | ![]() |
0.780 | D0WY9N | ![]() |
0.318 | ||
| ENC000632 | ![]() |
0.763 | D0O6KE | ![]() |
0.234 | ||
| ENC000631 | ![]() |
0.588 | D04FBR | ![]() |
0.225 | ||
| ENC000920 | ![]() |
0.573 | D05CHI | ![]() |
0.217 | ||
| ENC005959 | ![]() |
0.554 | D0T5XN | ![]() |
0.215 | ||
| ENC005962 | ![]() |
0.514 | D0FX2Q | ![]() |
0.215 | ||
| ENC002621 | ![]() |
0.481 | D06GCK | ![]() |
0.208 | ||
| ENC002864 | ![]() |
0.443 | D03RTK | ![]() |
0.207 | ||
| ENC002620 | ![]() |
0.441 | D0L5FY | ![]() |
0.207 | ||
| ENC002677 | ![]() |
0.426 | D0G3DL | ![]() |
0.205 | ||