![]() |
Name |
Cordycepsidone A
|
Molecular Formula | C18H12O8 | |
IUPAC Name* |
5,18-dihydroxy-7,12-dimethyl-9,16-dioxo-2,10,15-trioxatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3(8),4,6,12,17-hexaene-4-carbaldehyde
|
|
SMILES |
CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C(=C4C(=C3C)COC4=O)O)C=O)O
|
|
InChI |
InChI=1S/C18H12O8/c1-6-3-10(20)8(4-19)15-11(6)18(23)26-14-7(2)9-5-24-17(22)12(9)13(21)16(14)25-15/h3-4,20-21H,5H2,1-2H3
|
|
InChIKey |
DCVXYIOOJVZZDC-UHFFFAOYSA-N
|
|
Synonyms |
Cordycepsidone A
|
|
CAS | NA | |
PubChem CID | 57382387 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 356.3 | ALogp: | 2.9 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.454 |
Caco-2 Permeability: | -5.155 | MDCK Permeability: | 0.00001480 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.326 | 20% Bioavailability (F20%): | 0.016 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 98.55% |
Volume Distribution (VD): | 0.427 | Fu: | 3.60% |
CYP1A2-inhibitor: | 0.766 | CYP1A2-substrate: | 0.117 |
CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.056 |
CYP2C9-inhibitor: | 0.659 | CYP2C9-substrate: | 0.29 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.154 |
CYP3A4-inhibitor: | 0.115 | CYP3A4-substrate: | 0.083 |
Clearance (CL): | 4.272 | Half-life (T1/2): | 0.528 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.01 |
Drug-inuced Liver Injury (DILI): | 0.464 | AMES Toxicity: | 0.035 |
Rat Oral Acute Toxicity: | 1 | Maximum Recommended Daily Dose: | 0.926 |
Skin Sensitization: | 0.8 | Carcinogencity: | 0.509 |
Eye Corrosion: | 0.019 | Eye Irritation: | 0.935 |
Respiratory Toxicity: | 0.555 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002865 | ![]() |
0.778 | D04FBR | ![]() |
0.244 | ||
ENC002620 | ![]() |
0.674 | D02PMO | ![]() |
0.227 | ||
ENC002677 | ![]() |
0.622 | D0Z4XW | ![]() |
0.225 | ||
ENC005960 | ![]() |
0.573 | D06XZW | ![]() |
0.208 | ||
ENC000631 | ![]() |
0.573 | D0FA2O | ![]() |
0.204 | ||
ENC000919 | ![]() |
0.547 | D0FX2Q | ![]() |
0.200 | ||
ENC002676 | ![]() |
0.541 | D01XWG | ![]() |
0.200 | ||
ENC000920 | ![]() |
0.510 | D03RTK | ![]() |
0.200 | ||
ENC005959 | ![]() |
0.505 | D01XDL | ![]() |
0.199 | ||
ENC000921 | ![]() |
0.500 | D07JHH | ![]() |
0.198 |