![]() |
Name |
(R)-5-methoxycarbonyl mullein
|
Molecular Formula | C12H12O5 | |
IUPAC Name* |
methyl8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-5-carboxylate
|
|
SMILES |
COC(=O)c1ccc(O)c2c1CC(C)OC2=O
|
|
InChI |
InChI=1S/C12H12O5/c1-6-5-8-7(11(14)16-2)3-4-9(13)10(8)12(15)17-6/h3-4,6,13H,5H2,1-2H3/t6-/m1/s1
|
|
InChIKey |
DNZSCKMZMWYBGM-ZCFIWIBFSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.22 | ALogp: | 1.3 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.752 |
Caco-2 Permeability: | -4.704 | MDCK Permeability: | 0.00002970 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.017 |
30% Bioavailability (F30%): | 0.8 |
Blood-Brain-Barrier Penetration (BBB): | 0.506 | Plasma Protein Binding (PPB): | 89.92% |
Volume Distribution (VD): | 0.712 | Fu: | 7.56% |
CYP1A2-inhibitor: | 0.945 | CYP1A2-substrate: | 0.787 |
CYP2C19-inhibitor: | 0.395 | CYP2C19-substrate: | 0.21 |
CYP2C9-inhibitor: | 0.451 | CYP2C9-substrate: | 0.906 |
CYP2D6-inhibitor: | 0.452 | CYP2D6-substrate: | 0.481 |
CYP3A4-inhibitor: | 0.399 | CYP3A4-substrate: | 0.156 |
Clearance (CL): | 13.45 | Half-life (T1/2): | 0.709 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.118 |
Drug-inuced Liver Injury (DILI): | 0.744 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.025 | Maximum Recommended Daily Dose: | 0.151 |
Skin Sensitization: | 0.529 | Carcinogencity: | 0.067 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.735 |
Respiratory Toxicity: | 0.182 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005940 | ![]() |
0.745 | D07MGA | ![]() |
0.274 | ||
ENC004808 | ![]() |
0.745 | D0U0OT | ![]() |
0.265 | ||
ENC002309 | ![]() |
0.647 | D01WJL | ![]() |
0.250 | ||
ENC003237 | ![]() |
0.621 | D0C4YC | ![]() |
0.250 | ||
ENC005939 | ![]() |
0.615 | D0U7GP | ![]() |
0.247 | ||
ENC002310 | ![]() |
0.582 | D01JGV | ![]() |
0.247 | ||
ENC001305 | ![]() |
0.500 | D04JHN | ![]() |
0.247 | ||
ENC002082 | ![]() |
0.491 | D0S2BT | ![]() |
0.246 | ||
ENC000584 | ![]() |
0.491 | D07JGT | ![]() |
0.243 | ||
ENC000856 | ![]() |
0.491 | D08LTU | ![]() |
0.243 |