![]() |
Name |
(1S,6R,7S,10R)-10-hydroxy-4(5)-muurolen-3-one
|
Molecular Formula | C15H26O2 | |
IUPAC Name* |
1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalene-1,7-diol
|
|
SMILES |
CC1=CC2C(C(C)C)CCC(C)(O)C2CC1O
|
|
InChI |
InChI=1S/C15H26O2/c1-9(2)11-5-6-15(4,17)13-8-14(16)10(3)7-12(11)13/h7,9,11-14,16-17H,5-6,8H2,1-4H3/t11-,12-,13-,14-,15+/m0/s1
|
|
InChIKey |
DGZPYTSARMEKSO-YYFQZIEXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 238.37 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.686 |
Caco-2 Permeability: | -4.42 | MDCK Permeability: | 0.00001990 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.027 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.105 |
30% Bioavailability (F30%): | 0.118 |
Blood-Brain-Barrier Penetration (BBB): | 0.853 | Plasma Protein Binding (PPB): | 83.63% |
Volume Distribution (VD): | 1.161 | Fu: | 9.40% |
CYP1A2-inhibitor: | 0.06 | CYP1A2-substrate: | 0.425 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.897 |
CYP2C9-inhibitor: | 0.113 | CYP2C9-substrate: | 0.432 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.285 |
CYP3A4-inhibitor: | 0.062 | CYP3A4-substrate: | 0.54 |
Clearance (CL): | 15.255 | Half-life (T1/2): | 0.167 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.2 |
Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.167 | Maximum Recommended Daily Dose: | 0.033 |
Skin Sensitization: | 0.048 | Carcinogencity: | 0.055 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.056 |
Respiratory Toxicity: | 0.109 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005929 | ![]() |
1.000 | D04CSZ | ![]() |
0.345 | ||
ENC002017 | ![]() |
0.630 | D0P0HT | ![]() |
0.245 | ||
ENC005928 | ![]() |
0.607 | D04GJN | ![]() |
0.242 | ||
ENC003125 | ![]() |
0.492 | D06AEO | ![]() |
0.234 | ||
ENC004915 | ![]() |
0.472 | D08SVH | ![]() |
0.233 | ||
ENC003266 | ![]() |
0.472 | D0G5CF | ![]() |
0.233 | ||
ENC000535 | ![]() |
0.458 | D08PIQ | ![]() |
0.229 | ||
ENC003050 | ![]() |
0.452 | D0I2SD | ![]() |
0.228 | ||
ENC004664 | ![]() |
0.415 | D04SFH | ![]() |
0.228 | ||
ENC003649 | ![]() |
0.388 | D0Z1FX | ![]() |
0.224 |