![]() |
Name |
Phomone C
|
Molecular Formula | C24H32O14 | |
IUPAC Name* |
dimethyl2,4-bis[3,5-bis(hydroxymethyl)-4-methoxy-6-oxopyran-2-yl]cyclobutane-1,3-dicarboxylate
|
|
SMILES |
COC(=O)C1C(c2oc(=O)c(CO)c(OC)c2CO)C(C(=O)OC)C1c1oc(=O)c(CO)c(OC)c1CO
|
|
InChI |
InChI=1S/C24H28O14/c1-33-17-9(5-25)19(37-21(29)11(17)7-27)13-15(23(31)35-3)14(16(13)24(32)36-4)20-10(6-26)18(34-2)12(8-28)22(30)38-20/h13-16,25-28H,5-8H2,1-4H3/t13?,14?,15-,16+
|
|
InChIKey |
VYCCXZIETMTCNA-STONLHKKSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 540.47 | ALogp: | -1.0 |
HBD: | 4 | HBA: | 14 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 212.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 38 | QED Weighted: | 0.281 |
Caco-2 Permeability: | -5.934 | MDCK Permeability: | 0.00005860 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.99 |
Human Intestinal Absorption (HIA): | 0.731 | 20% Bioavailability (F20%): | 0.874 |
30% Bioavailability (F30%): | 0.993 |
Blood-Brain-Barrier Penetration (BBB): | 0.402 | Plasma Protein Binding (PPB): | 42.89% |
Volume Distribution (VD): | 0.961 | Fu: | 22.66% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.975 |
CYP2C19-inhibitor: | 0.005 | CYP2C19-substrate: | 0.626 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.054 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.014 | CYP3A4-substrate: | 0.365 |
Clearance (CL): | 2.134 | Half-life (T1/2): | 0.841 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.928 |
Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.564 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.028 | Carcinogencity: | 0.012 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.064 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001651 | ![]() |
0.330 | D0WY9N | ![]() |
0.234 | ||
ENC004859 | ![]() |
0.330 | D09DHY | ![]() |
0.221 | ||
ENC005874 | ![]() |
0.320 | D0J4JM | ![]() |
0.215 | ||
ENC005876 | ![]() |
0.280 | D09HDR | ![]() |
0.214 | ||
ENC004503 | ![]() |
0.258 | D0T5XN | ![]() |
0.212 | ||
ENC004970 | ![]() |
0.257 | D0G8NJ | ![]() |
0.208 | ||
ENC004805 | ![]() |
0.255 | D0Q0PR | ![]() |
0.208 | ||
ENC002687 | ![]() |
0.254 | D0D4HN | ![]() |
0.206 | ||
ENC003190 | ![]() |
0.250 | D04TDQ | ![]() |
0.206 | ||
ENC003618 | ![]() |
0.248 | D07IPB | ![]() |
0.206 |