|
Name |
(S)-Elsinochrome A
|
| Molecular Formula | C30H24O10 | |
| IUPAC Name* |
(12S,13S)-12,13-diacetyl-9,16-dihydroxy-5,10,15,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3(8),4(21),5,9,15,17(22),19-nonaene-7,18-dione
|
|
| SMILES |
CC(=O)[C@H]1[C@@H](C2=C3C4=C1C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(=O)C
|
|
| InChI |
InChI=1S/C30H24O10/c1-9(31)15-16(10(2)32)26-24-22-18(28(36)30(26)40-6)12(34)8-14(38-4)20(22)19-13(37-3)7-11(33)17-21(19)23(24)25(15)29(39-5)27(17)35/h7-8,15-16,35-36H,1-6H3/t15-,16-/m0/s1
|
|
| InChIKey |
SVDUCZIGPIYIHQ-HOTGVXAUSA-N
|
|
| Synonyms |
Elsinochrome A; (S)-Elsinochrome A; 24568-67-0
|
|
| CAS | NA | |
| PubChem CID | 101821075 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 544.5 | ALogp: | 3.2 |
| HBD: | 2 | HBA: | 10 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 146.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 40 | QED Weighted: | 0.233 |
| Caco-2 Permeability: | -5.055 | MDCK Permeability: | 0.00000964 |
| Pgp-inhibitor: | 0.779 | Pgp-substrate: | 0.957 |
| Human Intestinal Absorption (HIA): | 0.893 | 20% Bioavailability (F20%): | 0 |
| 30% Bioavailability (F30%): | 0.009 |
| Blood-Brain-Barrier Penetration (BBB): | 0.079 | Plasma Protein Binding (PPB): | 69.49% |
| Volume Distribution (VD): | 1.348 | Fu: | 38.05% |
| CYP1A2-inhibitor: | 0.081 | CYP1A2-substrate: | 0.985 |
| CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.756 |
| CYP2C9-inhibitor: | 0.135 | CYP2C9-substrate: | 0.789 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.146 |
| CYP3A4-inhibitor: | 0.039 | CYP3A4-substrate: | 0.048 |
| Clearance (CL): | 1.951 | Half-life (T1/2): | 0.167 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.041 |
| Drug-inuced Liver Injury (DILI): | 0.814 | AMES Toxicity: | 0.12 |
| Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.08 |
| Skin Sensitization: | 0.117 | Carcinogencity: | 0.004 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.127 |
| Respiratory Toxicity: | 0.04 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001117 | ![]() |
0.831 | D09DHY | ![]() |
0.324 | ||
| ENC004029 | ![]() |
0.728 | D06GCK | ![]() |
0.321 | ||
| ENC001118 | ![]() |
0.714 | D02LZB | ![]() |
0.298 | ||
| ENC001454 | ![]() |
0.672 | D03RTK | ![]() |
0.257 | ||
| ENC001491 | ![]() |
0.510 | D0J4JM | ![]() |
0.241 | ||
| ENC003042 | ![]() |
0.424 | D01FFA | ![]() |
0.238 | ||
| ENC002093 | ![]() |
0.409 | D0V6OA | ![]() |
0.237 | ||
| ENC001501 | ![]() |
0.409 | D04TDQ | ![]() |
0.237 | ||
| ENC002002 | ![]() |
0.400 | D0C1SF | ![]() |
0.236 | ||
| ENC003154 | ![]() |
0.391 | D0G8NJ | ![]() |
0.233 | ||