|
Name |
Prenylterphenyllin D
|
| Molecular Formula | C25H24O5 | |
| IUPAC Name* |
2-(2,2-dimethylchromen-6-yl)-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol
|
|
| SMILES |
COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc2c(c1)C=CC(C)(C)O2
|
|
| InChI |
InChI=1S/C25H24O5/c1-25(2)12-11-16-13-17(7-10-20(16)30-25)22-21(28-3)14-19(24(29-4)23(22)27)15-5-8-18(26)9-6-15/h5-14,26-27H,1-4H3
|
|
| InChIKey |
SECVFRPHIBGJSV-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 404.46 | ALogp: | 5.6 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 68.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 30 | QED Weighted: | 0.576 |
| Caco-2 Permeability: | -4.817 | MDCK Permeability: | 0.00001610 |
| Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.017 |
| Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 100.71% |
| Volume Distribution (VD): | 0.551 | Fu: | 0.75% |
| CYP1A2-inhibitor: | 0.873 | CYP1A2-substrate: | 0.873 |
| CYP2C19-inhibitor: | 0.945 | CYP2C19-substrate: | 0.092 |
| CYP2C9-inhibitor: | 0.856 | CYP2C9-substrate: | 0.946 |
| CYP2D6-inhibitor: | 0.776 | CYP2D6-substrate: | 0.926 |
| CYP3A4-inhibitor: | 0.726 | CYP3A4-substrate: | 0.756 |
| Clearance (CL): | 4.073 | Half-life (T1/2): | 0.236 |
| hERG Blockers: | 0.558 | Human Hepatotoxicity (H-HT): | 0.784 |
| Drug-inuced Liver Injury (DILI): | 0.631 | AMES Toxicity: | 0.052 |
| Rat Oral Acute Toxicity: | 0.094 | Maximum Recommended Daily Dose: | 0.302 |
| Skin Sensitization: | 0.206 | Carcinogencity: | 0.409 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.035 |
| Respiratory Toxicity: | 0.614 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005866 | ![]() |
0.953 | D06GCK | ![]() |
0.354 | ||
| ENC005039 | ![]() |
0.660 | D06TJJ | ![]() |
0.333 | ||
| ENC000826 | ![]() |
0.638 | D0Q9ON | ![]() |
0.319 | ||
| ENC005870 | ![]() |
0.635 | D05HSC | ![]() |
0.285 | ||
| ENC005871 | ![]() |
0.635 | D06FOU | ![]() |
0.277 | ||
| ENC002858 | ![]() |
0.634 | D0W8WB | ![]() |
0.276 | ||
| ENC002452 | ![]() |
0.621 | D0V8HJ | ![]() |
0.276 | ||
| ENC005868 | ![]() |
0.604 | D08CCE | ![]() |
0.274 | ||
| ENC002776 | ![]() |
0.590 | D0AZ8C | ![]() |
0.273 | ||
| ENC002011 | ![]() |
0.587 | D07MGA | ![]() |
0.272 | ||