![]() |
Name |
2,3-dihydro-2,2-dimethylquinazolin-4(1H)-one
|
Molecular Formula | C10H12N2O | |
IUPAC Name* |
2,2-dimethyl-1,3-dihydroquinazolin-4-one
|
|
SMILES |
CC1(C)NC(=O)c2ccccc2N1
|
|
InChI |
InChI=1S/C10H12N2O/c1-10(2)11-8-6-4-3-5-7(8)9(13)12-10/h3-6,11H,1-2H3,(H,12,13)
|
|
InChIKey |
BXJMRXBQNLKDCI-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 176.22 | ALogp: | 1.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 41.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 13 | QED Weighted: | 0.635 |
Caco-2 Permeability: | -5.054 | MDCK Permeability: | 0.00009480 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.361 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.94 | Plasma Protein Binding (PPB): | 80.15% |
Volume Distribution (VD): | 0.932 | Fu: | 19.20% |
CYP1A2-inhibitor: | 0.884 | CYP1A2-substrate: | 0.86 |
CYP2C19-inhibitor: | 0.303 | CYP2C19-substrate: | 0.761 |
CYP2C9-inhibitor: | 0.066 | CYP2C9-substrate: | 0.779 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.295 |
CYP3A4-inhibitor: | 0.044 | CYP3A4-substrate: | 0.139 |
Clearance (CL): | 3.63 | Half-life (T1/2): | 0.612 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.303 |
Drug-inuced Liver Injury (DILI): | 0.953 | AMES Toxicity: | 0.126 |
Rat Oral Acute Toxicity: | 0.06 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.503 | Carcinogencity: | 0.049 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.447 |
Respiratory Toxicity: | 0.523 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001031 | ![]() |
0.367 | D01PZD | ![]() |
0.381 | ||
ENC004792 | ![]() |
0.346 | D07RGW | ![]() |
0.333 | ||
ENC004993 | ![]() |
0.339 | D03GET | ![]() |
0.333 | ||
ENC003914 | ![]() |
0.333 | D08EOD | ![]() |
0.328 | ||
ENC000746 | ![]() |
0.333 | D0U5RT | ![]() |
0.306 | ||
ENC001483 | ![]() |
0.328 | D09NIA | ![]() |
0.297 | ||
ENC004648 | ![]() |
0.324 | D0Y7RW | ![]() |
0.297 | ||
ENC006142 | ![]() |
0.321 | D08UMH | ![]() |
0.288 | ||
ENC000179 | ![]() |
0.318 | D0Z9NZ | ![]() |
0.286 | ||
ENC001741 | ![]() |
0.311 | D06DLI | ![]() |
0.281 |