![]() |
Name |
sorbicilliside B
|
Molecular Formula | C18H26O8 | |
IUPAC Name* |
1-[4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxy-5-methylphenyl]-6-hydroxyhexan-1-one
|
|
SMILES |
Cc1cc(C(=O)CCCCCO)c(O)cc1OC1OC(CO)C(O)C1O
|
|
InChI |
InChI=1S/C18H26O8/c1-10-7-11(12(21)5-3-2-4-6-19)13(22)8-14(10)25-18-17(24)16(23)15(9-20)26-18/h7-8,15-20,22-24H,2-6,9H2,1H3/t15-,16+,17+,18-/m1/s1
|
|
InChIKey |
RHBGIKOFDWBADG-VSZNYVQBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 370.4 | ALogp: | 0.3 |
HBD: | 5 | HBA: | 8 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 136.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 26 | QED Weighted: | 0.316 |
Caco-2 Permeability: | -5.473 | MDCK Permeability: | 0.00008970 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.101 |
Human Intestinal Absorption (HIA): | 0.906 | 20% Bioavailability (F20%): | 0.052 |
30% Bioavailability (F30%): | 0.974 |
Blood-Brain-Barrier Penetration (BBB): | 0.819 | Plasma Protein Binding (PPB): | 56.91% |
Volume Distribution (VD): | 0.488 | Fu: | 42.86% |
CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.071 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.116 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.297 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.174 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.069 |
Clearance (CL): | 6.986 | Half-life (T1/2): | 0.626 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.08 |
Drug-inuced Liver Injury (DILI): | 0.609 | AMES Toxicity: | 0.659 |
Rat Oral Acute Toxicity: | 0.088 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.072 | Carcinogencity: | 0.348 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.018 |
Respiratory Toxicity: | 0.042 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004787 | ![]() |
0.522 | D06BQU | ![]() |
0.400 | ||
ENC005772 | ![]() |
0.494 | D0G5AG | ![]() |
0.308 | ||
ENC004773 | ![]() |
0.467 | D05ZYM | ![]() |
0.294 | ||
ENC004797 | ![]() |
0.426 | D0S7DV | ![]() |
0.286 | ||
ENC001625 | ![]() |
0.415 | D0T5BC | ![]() |
0.279 | ||
ENC004909 | ![]() |
0.411 | D0H3KI | ![]() |
0.275 | ||
ENC004798 | ![]() |
0.411 | D01TNW | ![]() |
0.274 | ||
ENC005169 | ![]() |
0.404 | D0H3WI | ![]() |
0.272 | ||
ENC003752 | ![]() |
0.373 | D07XSN | ![]() |
0.272 | ||
ENC004076 | ![]() |
0.370 | D0Y7DP | ![]() |
0.272 |