![]() |
Name |
4-O-α-D-ribofuranose-3-hydroxymethyl-2-pentylphenol
|
Molecular Formula | C17H26O7 | |
IUPAC Name* |
2-[4-hydroxy-2-(hydroxymethyl)-3-pentylphenoxy]-5-(hydroxymethyl)oxolane-3,4-diol
|
|
SMILES |
CCCCCc1c(O)ccc(OC2OC(CO)C(O)C2O)c1CO
|
|
InChI |
InChI=1S/C17H26O7/c1-2-3-4-5-10-11(8-18)13(7-6-12(10)20)23-17-16(22)15(21)14(9-19)24-17/h6-7,14-22H,2-5,8-9H2,1H3/t14-,15-,16-,17+/m1/s1
|
|
InChIKey |
TZXGSVBWQVSZOZ-VQHPVUNQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 342.39 | ALogp: | 0.4 |
HBD: | 5 | HBA: | 7 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.444 |
Caco-2 Permeability: | -5.437 | MDCK Permeability: | 0.00007510 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.078 |
Human Intestinal Absorption (HIA): | 0.844 | 20% Bioavailability (F20%): | 0.094 |
30% Bioavailability (F30%): | 0.966 |
Blood-Brain-Barrier Penetration (BBB): | 0.411 | Plasma Protein Binding (PPB): | 60.10% |
Volume Distribution (VD): | 0.769 | Fu: | 37.91% |
CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.081 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.169 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.44 |
CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.37 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.055 |
Clearance (CL): | 4.374 | Half-life (T1/2): | 0.88 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.022 |
Drug-inuced Liver Injury (DILI): | 0.045 | AMES Toxicity: | 0.601 |
Rat Oral Acute Toxicity: | 0.274 | Maximum Recommended Daily Dose: | 0.003 |
Skin Sensitization: | 0.135 | Carcinogencity: | 0.184 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.041 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004773 | ![]() |
0.733 | D06BQU | ![]() |
0.476 | ||
ENC005773 | ![]() |
0.522 | D01TNW | ![]() |
0.309 | ||
ENC005772 | ![]() |
0.488 | D0H3KI | ![]() |
0.293 | ||
ENC000851 | ![]() |
0.434 | D0T5BC | ![]() |
0.293 | ||
ENC004076 | ![]() |
0.424 | D07XSN | ![]() |
0.287 | ||
ENC003628 | ![]() |
0.423 | D0Y7DP | ![]() |
0.287 | ||
ENC003625 | ![]() |
0.423 | D0G5AG | ![]() |
0.281 | ||
ENC001625 | ![]() |
0.407 | D0B8UJ | ![]() |
0.278 | ||
ENC003811 | ![]() |
0.390 | D0HR8Z | ![]() |
0.277 | ||
ENC003812 | ![]() |
0.390 | D07NSU | ![]() |
0.276 |