![]() |
Name |
Fusariumester F
|
Molecular Formula | C36H58O10 | |
IUPAC Name* |
12-(14-carboxy-13-hydroxy-3,5,7,12-tetramethyltetradeca-2,4-dienoyl)oxy-13-(hydroxymethyl)-3,5,7-trimethyltetradeca-2,4-dienedioicacid
|
|
SMILES |
CC(=CC(=O)O)C=C(C)CC(C)CCCCC(OC(=O)C=C(C)C=C(C)CC(C)CCCCC(O)C(C)C(=O)O)C(CO)C(=O)O
|
|
InChI |
InChI=1S/C36H58O10/c1-23(12-8-10-14-31(38)29(7)35(42)43)17-26(4)19-28(6)21-34(41)46-32(30(22-37)36(44)45)15-11-9-13-24(2)16-25(3)18-27(5)20-33(39)40/h18-21,23-24,29-32,37-38H,8-17,22H2,1-7H3,(H,39,40)(H,42,43)(H,44,45)/b25-18+,26-19+,27-20+,28-21+/t23-,24-,29+,30+,31-,32+/m1/s1
|
|
InChIKey |
KBBBDYHDRJLMOT-XZPBCXBBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 650.85 | ALogp: | 6.7 |
HBD: | 5 | HBA: | 7 |
Rotatable Bonds: | 24 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 178.7 | Aromatic Rings: | 0 |
Heavy Atoms: | 46 | QED Weighted: | 0.033 |
Caco-2 Permeability: | -5.963 | MDCK Permeability: | 0.00002490 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.957 |
Human Intestinal Absorption (HIA): | 0.986 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.876 |
Blood-Brain-Barrier Penetration (BBB): | 0.133 | Plasma Protein Binding (PPB): | 94.03% |
Volume Distribution (VD): | 0.496 | Fu: | 1.91% |
CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.087 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.092 |
CYP2C9-inhibitor: | 0.525 | CYP2C9-substrate: | 0.985 |
CYP2D6-inhibitor: | 0.195 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.014 |
Clearance (CL): | 1.035 | Half-life (T1/2): | 0.947 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.811 |
Drug-inuced Liver Injury (DILI): | 0.093 | AMES Toxicity: | 0 |
Rat Oral Acute Toxicity: | 0.047 | Maximum Recommended Daily Dose: | 0.59 |
Skin Sensitization: | 0.966 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.018 |
Respiratory Toxicity: | 0.03 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005667 | ![]() |
0.891 | D0D9NY | ![]() |
0.233 | ||
ENC005666 | ![]() |
0.781 | D0TP2W | ![]() |
0.230 | ||
ENC005665 | ![]() |
0.752 | D03JSJ | ![]() |
0.225 | ||
ENC005670 | ![]() |
0.492 | D00FSV | ![]() |
0.224 | ||
ENC005669 | ![]() |
0.485 | D0C3LP | ![]() |
0.209 | ||
ENC006085 | ![]() |
0.362 | D0RQ2W | ![]() |
0.204 | ||
ENC001858 | ![]() |
0.314 | D0ZI4H | ![]() |
0.204 | ||
ENC001818 | ![]() |
0.290 | D0N3NO | ![]() |
0.202 | ||
ENC001412 | ![]() |
0.290 | D0X4FM | ![]() |
0.201 | ||
ENC005267 | ![]() |
0.273 | D09XWD | ![]() |
0.199 |