![]() |
Name |
kipukasins P
|
Molecular Formula | C18H20N2O8 | |
IUPAC Name* |
[2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]2-hydroxy-4,6-dimethylbenzoate
|
|
SMILES |
Cc1cc(C)c(C(=O)OC2C(O)C(CO)OC2n2ccc(=O)[nH]c2=O)c(O)c1
|
|
InChI |
InChI=1S/C18H20N2O8/c1-8-5-9(2)13(10(22)6-8)17(25)28-15-14(24)11(7-21)27-16(15)20-4-3-12(23)19-18(20)26/h3-6,11,14-16,21-22,24H,7H2,1-2H3,(H,19,23,26)/t11-,14-,15-,16-/m1/s1
|
|
InChIKey |
PFSBARRSZWZELF-RAEVTNRLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 392.36 | ALogp: | -0.7 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 151.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.522 |
Caco-2 Permeability: | -6.104 | MDCK Permeability: | 0.00009700 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.276 |
Human Intestinal Absorption (HIA): | 0.942 | 20% Bioavailability (F20%): | 0.799 |
30% Bioavailability (F30%): | 0.956 |
Blood-Brain-Barrier Penetration (BBB): | 0.525 | Plasma Protein Binding (PPB): | 54.68% |
Volume Distribution (VD): | 0.375 | Fu: | 42.83% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.143 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.056 |
CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.141 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.12 |
CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.186 |
Clearance (CL): | 11.33 | Half-life (T1/2): | 0.785 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.297 |
Drug-inuced Liver Injury (DILI): | 0.986 | AMES Toxicity: | 0.025 |
Rat Oral Acute Toxicity: | 0.026 | Maximum Recommended Daily Dose: | 0.013 |
Skin Sensitization: | 0.052 | Carcinogencity: | 0.042 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005638 | ![]() |
0.767 | D0Y7DP | ![]() |
0.506 | ||
ENC002576 | ![]() |
0.703 | D0OL7F | ![]() |
0.390 | ||
ENC002632 | ![]() |
0.537 | D03TGJ | ![]() |
0.340 | ||
ENC000126 | ![]() |
0.506 | D07XSN | ![]() |
0.326 | ||
ENC002972 | ![]() |
0.384 | D0CL9S | ![]() |
0.326 | ||
ENC005169 | ![]() |
0.375 | D0R2KF | ![]() |
0.296 | ||
ENC003952 | ![]() |
0.364 | D0G5AG | ![]() |
0.292 | ||
ENC003813 | ![]() |
0.350 | D0Z8EX | ![]() |
0.290 | ||
ENC002973 | ![]() |
0.350 | D0D4YZ | ![]() |
0.289 | ||
ENC003748 | ![]() |
0.347 | D0TS1Z | ![]() |
0.284 |