NPs Basic Information
|
Name |
6,7-(2′E)dibutenyl-5,8-dihydroxy-(Z)-cyclooct-2-ene-1,4-dione
|
| Molecular Formula | C17H20O7 | |
| IUPAC Name* |
[2,7-dihydroxy-3,6-dioxo-8-(2-oxopent-3-enyl)cyclooct-4-en-1-yl]but-2-enoate
|
|
| SMILES |
CC=CC(=O)CC1C(O)C(=O)C=CC(=O)C(O)C1OC(=O)C=CC
|
|
| InChI |
InChI=1S/C17H20O7/c1-3-5-10(18)9-11-15(22)12(19)7-8-13(20)16(23)17(11)24-14(21)6-4-2/h3-8,11,15-17,22-23H,9H2,1-2H3/b5-3+,6-4+,8-7-/t11-,15+,16+,17-/m0/s1
|
|
| InChIKey |
SNUVXDDNDFDPHL-YEXSRLESSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 336.34 | ALogp: | 0.1 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 118.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 24 | QED Weighted: | 0.553 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.629 | MDCK Permeability: | 0.00002260 |
| Pgp-inhibitor: | 0.181 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.925 | 20% Bioavailability (F20%): | 0.035 |
| 30% Bioavailability (F30%): | 0.81 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.907 | Plasma Protein Binding (PPB): | 73.53% |
| Volume Distribution (VD): | 0.214 | Fu: | 29.79% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.071 |
| CYP2C19-inhibitor: | 0.071 | CYP2C19-substrate: | 0.096 |
| CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.372 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.217 |
| CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.192 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.609 | Half-life (T1/2): | 0.92 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.204 |
| Drug-inuced Liver Injury (DILI): | 0.179 | AMES Toxicity: | 0.092 |
| Rat Oral Acute Toxicity: | 0.721 | Maximum Recommended Daily Dose: | 0.894 |
| Skin Sensitization: | 0.533 | Carcinogencity: | 0.794 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.027 |
| Respiratory Toxicity: | 0.7 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005953 |  |
0.273 | D0OL7F |  |
0.218 | ||
| ENC003986 |  |
0.258 | D09SIK |  |
0.207 | ||
| ENC003985 |  |
0.258 | D0KN2M |  |
0.204 | ||
| ENC001843 |  |
0.257 | D0E9KA |  |
0.197 | ||
| ENC004776 |  |
0.253 | D0FG6M |  |
0.192 | ||
| ENC001864 |  |
0.250 | D02RQU |  |
0.189 | ||
| ENC005640 |  |
0.250 | D0X2UE |  |
0.186 | ||
| ENC001917 |  |
0.248 | D0A7MY |  |
0.184 | ||
| ENC001761 |  |
0.244 | D0Y7DP |  |
0.183 | ||
| ENC003429 |  |
0.241 | D0ZI4H |  |
0.182 | ||