![]() |
Name |
Terrein
|
Molecular Formula | C8H10O3 | |
IUPAC Name* |
(4S,5R)-4,5-dihydroxy-3-[(E)-prop-1-enyl]cyclopent-2-en-1-one
|
|
SMILES |
C/C=C/C1=CC(=O)[C@@H]([C@H]1O)O
|
|
InChI |
InChI=1S/C8H10O3/c1-2-3-5-4-6(9)8(11)7(5)10/h2-4,7-8,10-11H,1H3/b3-2+/t7-,8-/m0/s1
|
|
InChIKey |
MHOOPNKRBMHHEC-HZIBQTDNSA-N
|
|
Synonyms |
Terrein; 582-46-7; (+)Terrein; NSC 291308; 3I47HPE16N; NSC-291308; (4S,5R)-4,5-dihydroxy-3-[(E)-prop-1-enyl]cyclopent-2-en-1-one; UNII-3I47HPE16N; Terrain; 2-Cyclopenten-1-one, 4,5-dihydroxy-3-propenyl-; TERREIN [INCI]; (+)-TERREIN; CHEMBL506722; MEGxm0_000160; SCHEMBL1884980; ACon1_001984; MHOOPNKRBMHHEC-HZIBQTDNSA-; 2-Cyclopenten-1-one, 4,5-dihydroxy-3-(1-propenyl)-, (4S-(3(E),4.alpha.,5.beta.))-; CHEBI:177543; DTXSID101017469; MFCD09752761; AKOS006327725; ZINC100020097; NCGC00179945-01; HY-119808; CS-0078056; BRD-K68034638-001-01-1; Q27257243; 3-(1-Propenyl)-4alpha,5beta-dihydroxy-2-cyclopenten-1-one; (4S,5R)-4,5-dihydroxy-3-(1E)-1-propen-1-yl-2-cyclopenten-1-one; 2-Cyclopenten-1-one, 4,5-dihydroxy-3-(1E)-1-propenyl-, (4S,5R)-; 2-Cyclopenten-1-one, 4,5-dihydroxy-3-(1-propenyl)-, (4S-(3(E),4alpha,5beta))-; 2-CYCLOPENTEN-1-ONE, 4,5-DIHYDROXY-3-(1E)-1-PROPEN-1-YL-, (4S,5R)-
|
|
CAS | 582-46-7 | |
PubChem CID | 6436830 | |
ChEMBL ID | CHEMBL506722 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.16 | ALogp: | -0.6 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.567 |
Caco-2 Permeability: | -4.492 | MDCK Permeability: | 0.00003520 |
Pgp-inhibitor: | 0.437 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.027 |
Blood-Brain-Barrier Penetration (BBB): | 0.327 | Plasma Protein Binding (PPB): | 80.65% |
Volume Distribution (VD): | 0.199 | Fu: | 11.75% |
CYP1A2-inhibitor: | 0.653 | CYP1A2-substrate: | 0.763 |
CYP2C19-inhibitor: | 0.226 | CYP2C19-substrate: | 0.671 |
CYP2C9-inhibitor: | 0.048 | CYP2C9-substrate: | 0.494 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.293 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.209 |
Clearance (CL): | 7.328 | Half-life (T1/2): | 0.583 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.092 |
Drug-inuced Liver Injury (DILI): | 0.514 | AMES Toxicity: | 0.774 |
Rat Oral Acute Toxicity: | 0.346 | Maximum Recommended Daily Dose: | 0.21 |
Skin Sensitization: | 0.757 | Carcinogencity: | 0.361 |
Eye Corrosion: | 0.86 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.532 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003001 | ![]() |
0.486 | D03TGJ | ![]() |
0.203 | ||
ENC002664 | ![]() |
0.486 | D03KXY | ![]() |
0.194 | ||
ENC003622 | ![]() |
0.474 | D0YX4S | ![]() |
0.184 | ||
ENC006061 | ![]() |
0.415 | D0Y7DP | ![]() |
0.172 | ||
ENC004404 | ![]() |
0.327 | D07XSN | ![]() |
0.172 | ||
ENC001753 | ![]() |
0.293 | D09FAZ | ![]() |
0.172 | ||
ENC001761 | ![]() |
0.283 | D0CL9S | ![]() |
0.172 | ||
ENC005953 | ![]() |
0.283 | D0L1WV | ![]() |
0.164 | ||
ENC001883 | ![]() |
0.283 | D0V9EN | ![]() |
0.164 | ||
ENC005124 | ![]() |
0.283 | D0R2KF | ![]() |
0.159 |