![]() |
Name |
spiro [5H,10H-dipyrrolo[1,2-a:1′,2′-d]pyrazine-2(3H),2′-[2H]indole]-3′,5,10(1′H)-trione
|
Molecular Formula | C22H25N3O6 | |
IUPAC Name* |
3,4-dihydroxy-6'-methoxy-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,2'-1H-indole]-2,3',8-trione
|
|
SMILES |
COc1ccc2c(c1)NC1(C2=O)C(C=C(C)C)N2C(=O)C3CCCN3C(=O)C2(O)C1O
|
|
InChI |
InChI=1S/C22H25N3O6/c1-11(2)9-16-21(17(26)13-7-6-12(31-3)10-14(13)23-21)19(28)22(30)20(29)24-8-4-5-15(24)18(27)25(16)22/h6-7,9-10,15-16,19,23,28,30H,4-5,8H2,1-3H3/t15?,16-,19-,21+,22+/m0/s1
|
|
InChIKey |
XPLQKNTVQRYSHU-ZUKNYGIXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 427.46 | ALogp: | 0.3 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 31 | QED Weighted: | 0.594 |
Caco-2 Permeability: | -5.314 | MDCK Permeability: | 0.00000510 |
Pgp-inhibitor: | 0.465 | Pgp-substrate: | 0.838 |
Human Intestinal Absorption (HIA): | 0.794 | 20% Bioavailability (F20%): | 0.891 |
30% Bioavailability (F30%): | 0.864 |
Blood-Brain-Barrier Penetration (BBB): | 0.212 | Plasma Protein Binding (PPB): | 84.68% |
Volume Distribution (VD): | 1.205 | Fu: | 15.52% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.127 |
CYP2C19-inhibitor: | 0.133 | CYP2C19-substrate: | 0.818 |
CYP2C9-inhibitor: | 0.133 | CYP2C9-substrate: | 0.539 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.133 |
CYP3A4-inhibitor: | 0.197 | CYP3A4-substrate: | 0.929 |
Clearance (CL): | 4.289 | Half-life (T1/2): | 0.138 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.731 |
Drug-inuced Liver Injury (DILI): | 0.975 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.374 | Maximum Recommended Daily Dose: | 0.444 |
Skin Sensitization: | 0.155 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.117 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005204 | ![]() |
0.663 | D06YFA | ![]() |
0.275 | ||
ENC003264 | ![]() |
0.600 | D01TSI | ![]() |
0.261 | ||
ENC001958 | ![]() |
0.600 | D02IQY | ![]() |
0.259 | ||
ENC003265 | ![]() |
0.555 | D06HBQ | ![]() |
0.253 | ||
ENC002020 | ![]() |
0.551 | D0SP3D | ![]() |
0.246 | ||
ENC002520 | ![]() |
0.537 | D09NNH | ![]() |
0.246 | ||
ENC000837 | ![]() |
0.521 | D0V3ZA | ![]() |
0.246 | ||
ENC002260 | ![]() |
0.508 | D09OBB | ![]() |
0.243 | ||
ENC003281 | ![]() |
0.496 | D0Q5NX | ![]() |
0.243 | ||
ENC002064 | ![]() |
0.495 | D0J1ML | ![]() |
0.240 |