|
Name |
Fumitremorgin B
|
| Molecular Formula | C27H33N3O5 | |
| IUPAC Name* |
(1R,2S,12S,15S)-1,2-dihydroxy-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione
|
|
| SMILES |
CC(=CCN1C2=C(C=CC(=C2)OC)C3=C1[C@@H](N4C(=O)[C@@H]5CCCN5C(=O)[C@@]4([C@H]3O)O)C=C(C)C)C
|
|
| InChI |
InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1
|
|
| InChIKey |
WEIYXEFMCIRZHC-MWGWWEMPSA-N
|
|
| Synonyms |
Fumitremorgin B; Lanosulin; 12626-17-4; Fumitremorgen B; (5ar,6s,12s,14as)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5h,14h-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione; ITN5B384F8; UNII-ITN5B384F8; 5H,14H-Pyrrolo(1'',2'':4',5')pyrazino(1',2':1,6)pyrido(3,4-b)indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-butenyl)-12-(2-methyl-1-propenyl)-, (5aR,6S,12S,14aS)-; SCHEMBL3127635; CHEMBL3885413; CHEBI:64531; DTXSID70925478; NA-209B; 5H,14H-Pyrrolo(1'',2'':4',5')pyrazino(1',2':1,6)pyrido(3,4-b)indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-butenyl)-12-(2-methyl-1-propenyl)-, (5aR-(5a-alpha,6-alpha,12-beta,14a-alpha))-; HY-117313; CS-0065271; C20630; Q27133338; (1R,2S,12S,15S)-1,2-dihydroxy-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione; 1,2-Dihydroxy-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione; 4Q1; 5H,14H-PYRROLO(1'',2'':4',5')PYRAZINO(1',2':1,6)PYRIDO(3,4-B)INDOLE-5,14-DIONE, 1,2,3,5A,6,11,12,14A-OCTAHYDRO-5A,6-DIHYDROXY-9-METHOXY-11-(3-METHYL-2-BUTEN-1-YL)-12-(2-METHYL-1-PROPEN-1-YL)-, (5AR,6S,12S,14AS)-
|
|
| CAS | 12626-17-4 | |
| PubChem CID | 105113 | |
| ChEMBL ID | CHEMBL3885413 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 479.6 | ALogp: | 2.7 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 95.2 | Aromatic Rings: | 5 |
| Heavy Atoms: | 35 | QED Weighted: | 0.647 |
| Caco-2 Permeability: | -4.841 | MDCK Permeability: | 0.00001130 |
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.959 |
| Human Intestinal Absorption (HIA): | 0.763 | 20% Bioavailability (F20%): | 0.219 |
| 30% Bioavailability (F30%): | 0.965 |
| Blood-Brain-Barrier Penetration (BBB): | 0.843 | Plasma Protein Binding (PPB): | 88.58% |
| Volume Distribution (VD): | 1.749 | Fu: | 6.14% |
| CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.094 |
| CYP2C19-inhibitor: | 0.74 | CYP2C19-substrate: | 0.901 |
| CYP2C9-inhibitor: | 0.836 | CYP2C9-substrate: | 0.903 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.144 |
| CYP3A4-inhibitor: | 0.79 | CYP3A4-substrate: | 0.929 |
| Clearance (CL): | 10.393 | Half-life (T1/2): | 0.136 |
| hERG Blockers: | 0.126 | Human Hepatotoxicity (H-HT): | 0.988 |
| Drug-inuced Liver Injury (DILI): | 0.981 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.119 | Maximum Recommended Daily Dose: | 0.992 |
| Skin Sensitization: | 0.141 | Carcinogencity: | 0.696 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.946 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003281 | ![]() |
0.761 | D06YFA | ![]() |
0.265 | ||
| ENC001958 | ![]() |
0.673 | D0W6DG | ![]() |
0.262 | ||
| ENC003264 | ![]() |
0.673 | D02IQY | ![]() |
0.250 | ||
| ENC002260 | ![]() |
0.636 | D0Y5RZ | ![]() |
0.247 | ||
| ENC003265 | ![]() |
0.596 | D01TSI | ![]() |
0.237 | ||
| ENC000842 | ![]() |
0.594 | D06HBQ | ![]() |
0.236 | ||
| ENC002064 | ![]() |
0.540 | D0Q0PR | ![]() |
0.236 | ||
| ENC003013 | ![]() |
0.534 | D0P0RX | ![]() |
0.232 | ||
| ENC005479 | ![]() |
0.521 | D0J5TS | ![]() |
0.232 | ||
| ENC002846 | ![]() |
0.484 | D0R1RS | ![]() |
0.231 | ||