![]() |
Name |
Peniaphilone C
|
Molecular Formula | C19H25ClO5 | |
IUPAC Name* |
5-chloro-7,8-dihydroxy-3-(7-hydroxy-3,5-dimethylhepta-1,3-dienyl)-7-methyl-8,8a-dihydro-1H-isochromen-6-one
|
|
SMILES |
CC(C=CC1=CC2=C(Cl)C(=O)C(C)(O)C(O)C2CO1)=CC(C)CCO
|
|
InChI |
InChI=1S/C19H25ClO5/c1-11(8-12(2)6-7-21)4-5-13-9-14-15(10-25-13)17(22)19(3,24)18(23)16(14)20/h4-5,8-9,12,15,17,21-22,24H,6-7,10H2,1-3H3/b5-4+,11-8+/t12-,15+,17+,19+/m0/s1
|
|
InChIKey |
DNFOKEVJUAZXRE-MCPDCSDXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 368.86 | ALogp: | 2.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 25 | QED Weighted: | 0.649 |
Caco-2 Permeability: | -4.879 | MDCK Permeability: | 0.00002140 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.682 |
Human Intestinal Absorption (HIA): | 0.727 | 20% Bioavailability (F20%): | 0.835 |
30% Bioavailability (F30%): | 0.094 |
Blood-Brain-Barrier Penetration (BBB): | 0.99 | Plasma Protein Binding (PPB): | 91.59% |
Volume Distribution (VD): | 2.206 | Fu: | 4.90% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.11 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.861 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.064 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.067 |
CYP3A4-inhibitor: | 0.242 | CYP3A4-substrate: | 0.458 |
Clearance (CL): | 5.555 | Half-life (T1/2): | 0.859 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.393 |
Drug-inuced Liver Injury (DILI): | 0.903 | AMES Toxicity: | 0.376 |
Rat Oral Acute Toxicity: | 0.881 | Maximum Recommended Daily Dose: | 0.982 |
Skin Sensitization: | 0.926 | Carcinogencity: | 0.441 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.025 |
Respiratory Toxicity: | 0.97 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001875 | ![]() |
0.819 | D0C8HR | ![]() |
0.207 | ||
ENC005595 | ![]() |
0.753 | D04VIS | ![]() |
0.205 | ||
ENC005432 | ![]() |
0.750 | D02GAC | ![]() |
0.195 | ||
ENC005433 | ![]() |
0.714 | D0F1EX | ![]() |
0.193 | ||
ENC001877 | ![]() |
0.616 | D07DVK | ![]() |
0.193 | ||
ENC001871 | ![]() |
0.616 | D0S7WX | ![]() |
0.192 | ||
ENC005436 | ![]() |
0.614 | D0E9KA | ![]() |
0.192 | ||
ENC005435 | ![]() |
0.614 | D0R2KF | ![]() |
0.192 | ||
ENC005596 | ![]() |
0.596 | D06AEO | ![]() |
0.190 | ||
ENC001884 | ![]() |
0.573 | D08PIQ | ![]() |
0.186 |