![]() |
Name |
Isochromophilone IV
|
Molecular Formula | C21H27ClO5 | |
IUPAC Name* |
[(7R,8R,8aR)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate
|
|
SMILES |
CC[C@H](C)/C=C(\C)/C=C/C1=CC2=C(C(=O)[C@]([C@@H]([C@H]2CO1)OC(=O)C)(C)O)Cl
|
|
InChI |
InChI=1S/C21H27ClO5/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-26-15)20(27-14(4)23)21(5,25)19(24)18(16)22/h7-10,12,17,20,25H,6,11H2,1-5H3/b8-7+,13-9+/t12-,17-,20+,21-/m0/s1
|
|
InChIKey |
MMOJJYPBNVVCGY-CTQGMABPSA-N
|
|
Synonyms |
Isochromophilone IV; 167173-90-2; [(7R,8R,8aR)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate; 6H-2-Benzopyran-6-one, 5-(acetyloxy)-5-chloro-3-(3,5-dimethyl-1,3-heptadienyl)-1,7,8,8a-tetrahydro-7-hydroxy-7-methyl; ZINC33985684; NCGC00380255-01; 3-[(1E,3E,5S)-3,5-Dimethyl-1,3-heptadienyl]-5-chloro-7-methyl-7alpha-hydroxy-8alpha-acetoxy-1,7,8,8aalpha-tetrahydro-6H-2-benzopyran-6-one; NCGC00380255-01_C21H27ClO5_6H-2-Benzopyran-6-one, 8-(acetyloxy)-5-chloro-3-[(1E,3E,5S)-3,5-dimethyl-1,3-heptadien-1-yl]-1,7,8,8a-tetrahydro-7-hydroxy-7-methyl-, (7R,8R,8aR)-
|
|
CAS | 167173-90-2 | |
PubChem CID | 6451122 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 394.9 | ALogp: | 4.1 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 27 | QED Weighted: | 0.549 |
Caco-2 Permeability: | -4.573 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.094 | Pgp-substrate: | 0.373 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.038 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.632 | Plasma Protein Binding (PPB): | 94.47% |
Volume Distribution (VD): | 2.73 | Fu: | 8.03% |
CYP1A2-inhibitor: | 0.43 | CYP1A2-substrate: | 0.112 |
CYP2C19-inhibitor: | 0.354 | CYP2C19-substrate: | 0.804 |
CYP2C9-inhibitor: | 0.277 | CYP2C9-substrate: | 0.094 |
CYP2D6-inhibitor: | 0.219 | CYP2D6-substrate: | 0.104 |
CYP3A4-inhibitor: | 0.864 | CYP3A4-substrate: | 0.564 |
Clearance (CL): | 4.617 | Half-life (T1/2): | 0.831 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.328 |
Drug-inuced Liver Injury (DILI): | 0.978 | AMES Toxicity: | 0.904 |
Rat Oral Acute Toxicity: | 0.854 | Maximum Recommended Daily Dose: | 0.983 |
Skin Sensitization: | 0.93 | Carcinogencity: | 0.347 |
Eye Corrosion: | 0.92 | Eye Irritation: | 0.907 |
Respiratory Toxicity: | 0.971 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001871 | ![]() |
1.000 | D05QDC | ![]() |
0.225 | ||
ENC001875 | ![]() |
0.744 | D0G3PI | ![]() |
0.224 | ||
ENC005596 | ![]() |
0.742 | D00DKK | ![]() |
0.224 | ||
ENC005595 | ![]() |
0.729 | D02DGU | ![]() |
0.224 | ||
ENC005432 | ![]() |
0.586 | D0B1IP | ![]() |
0.224 | ||
ENC001884 | ![]() |
0.558 | D0S7WX | ![]() |
0.217 | ||
ENC002178 | ![]() |
0.548 | D0E9KA | ![]() |
0.213 | ||
ENC001876 | ![]() |
0.511 | D02CNR | ![]() |
0.211 | ||
ENC001841 | ![]() |
0.500 | D0H2MO | ![]() |
0.210 | ||
ENC005594 | ![]() |
0.480 | D0V2JK | ![]() |
0.207 |