|
Name |
Aspergillussanone I
|
| Molecular Formula | C38H50O8 | |
| IUPAC Name* |
2,4,6,9-tetrahydroxy-5,7-dimethyl-2-[3,7,11-trimethyl-13-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)trideca-2,6,10-trienyl]phenalene-1,3-dione
|
|
| SMILES |
CC(=CCCC(C)=CCC1(O)C(=O)c2c(O)cc(C)c3c(O)c(C)c(O)c(c23)C1=O)CCC=C(C)CCC1OC(C)(C)OC1(C)C
|
|
| InChI |
InChI=1S/C38H50O8/c1-21(12-10-14-22(2)16-17-27-36(6,7)46-37(8,9)45-27)13-11-15-23(3)18-19-38(44)34(42)29-26(39)20-24(4)28-30(29)31(35(38)43)33(41)25(5)32(28)40/h13-14,18,20,27,39-41,44H,10-12,15-17,19H2,1-9H3/b21-13+,22-14+,23-18+/t27?,38-/m0/s1
|
|
| InChIKey |
WQVQGYAICGPPAB-NNLMPRKCSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 634.81 | ALogp: | 8.2 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 133.5 | Aromatic Rings: | 4 |
| Heavy Atoms: | 46 | QED Weighted: | 0.136 |
| Caco-2 Permeability: | -4.713 | MDCK Permeability: | 0.00001310 |
| Pgp-inhibitor: | 0.987 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.044 | 20% Bioavailability (F20%): | 0.973 |
| 30% Bioavailability (F30%): | 0.042 |
| Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 96.83% |
| Volume Distribution (VD): | 2.224 | Fu: | 3.18% |
| CYP1A2-inhibitor: | 0.088 | CYP1A2-substrate: | 0.234 |
| CYP2C19-inhibitor: | 0.727 | CYP2C19-substrate: | 0.429 |
| CYP2C9-inhibitor: | 0.903 | CYP2C9-substrate: | 0.91 |
| CYP2D6-inhibitor: | 0.485 | CYP2D6-substrate: | 0.137 |
| CYP3A4-inhibitor: | 0.28 | CYP3A4-substrate: | 0.473 |
| Clearance (CL): | 2.355 | Half-life (T1/2): | 0.01 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.85 |
| Drug-inuced Liver Injury (DILI): | 0.926 | AMES Toxicity: | 0.508 |
| Rat Oral Acute Toxicity: | 0.064 | Maximum Recommended Daily Dose: | 0.402 |
| Skin Sensitization: | 0.15 | Carcinogencity: | 0.959 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.386 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003494 | ![]() |
0.674 | D03VFL | ![]() |
0.305 | ||
| ENC003114 | ![]() |
0.644 | D09XWD | ![]() |
0.297 | ||
| ENC003842 | ![]() |
0.635 | D05XQE | ![]() |
0.271 | ||
| ENC003496 | ![]() |
0.635 | D0WY9N | ![]() |
0.256 | ||
| ENC005337 | ![]() |
0.631 | D0FX2Q | ![]() |
0.249 | ||
| ENC005338 | ![]() |
0.630 | D0Q0PR | ![]() |
0.235 | ||
| ENC005339 | ![]() |
0.611 | D01ZUA | ![]() |
0.233 | ||
| ENC005340 | ![]() |
0.596 | D0G3DL | ![]() |
0.216 | ||
| ENC003495 | ![]() |
0.576 | D04ITO | ![]() |
0.215 | ||
| ENC004068 | ![]() |
0.383 | D05CHI | ![]() |
0.210 | ||